Fluorinated Polymer Water Oil Repellency Phenylene Linking
Find Innovative SolutionsGenerate Solutions
Solution Overview
Problem
Existing fluorinated polymers with perfluoroalkyl groups (RF) having at least 8 carbon atoms pose environmental concerns due to decomposition and low water/oil repellency when using monomers with RF groups having at most 6 carbon atoms results in insufficient durability and repellency.
Innovation Solution
A fluorinated compound with an RF group of at most 6 carbon atoms, represented by the formula CH2═C(M)COOXPhCOO(CH2)mCrF2r+1, is polymerized to create a durable water/oil repellent polymer with a phenylene linking group, enhancing surface orientation and repellency.
Engineering Contradictions & Design Principles
Engineering Contradiction Analysis
1Reliability
If a polymer is made from a monomer having an RF group with at least 8 carbon atoms, then water/oil repellency and surface orientation are improved, but environmental load increases due to decomposition and accumulation
Solution Approach 1:
The invention changes the carbon atom number parameter of the RF group from 8 or more to 6 or less, thereby reducing environmental load while maintaining water/oil repellency through optimized molecular structure with phenylene linking groups and specific ester bond configurations
Solution Approach 2:
The invention creates a composite molecular structure combining RF groups with phenylene linking groups and specific ester bonds, achieving both environmental friendliness and high performance water/oil repellency that neither component could achieve alone
2Object-affected harmful factors
If a polymer is made from a monomer having an RF group with at most 6 carbon atoms, then environmental load is reduced, but water/oil repellency and durability are insufficient due to weak RF orientation at the surface
Solution Approach 1:
The invention constructs a composite molecular structure where RF groups are connected through phenylene linking groups and ester bonds, creating a synergistic effect that enhances surface orientation and water/oil repellency beyond what simple short-chain RF groups could achieve
Solution Approach 2:
The invention optimizes the local molecular structure around the RF group by introducing phenylene linking groups and specific ester bond configurations, creating localized regions of high electron density and rigid structure that promote surface orientation and enhance repellency
Applied Scientific Principles
This section explains which scientific principles are used to turn an abstract innovation direction into a practical engineering solution.
Function Achieved in This Case
The resulting polymer exhibits highly durable water/oil repellency with reduced environmental impact, maintaining performance over time and offering a lower environmental load compared to traditional polymers.
Implementation Method 1
a polymer comprising polymerized units of a polymerizable monomer containing a polyfluoroalkyl group
Implementation Method 2
surface orientation of Rf groups on the coating film. It has been taken for granted that in order to attain both water repellency and oil repellency, orientation of Rf groups at the surface is important
Data Source
AI summary
To provide a fluorinated compound having an RF group with at most 6 carbon atoms, whereby a fluorinated polymer having a highly durable water/oil repellency can be produced, and an environmental load is little, and a fluorinated polymer having a highly durable water/oil repellency and presenting little environmental load, obtainable by polymerizing such a fluorinated compound. A fluorinated compound represented by the following formula (I) and its polymer:CH2═C(M)COOXPhCOO(CH2)mCrF2r+1 (I)(in the formula (I), M is a hydrogen atom, a methyl group or a halogen atom, X is CHR1CH2O or CH2CHR1O, R1 is a C1-4 linear or branched alkyl group or CH2OR2, R2 is a C1-4 linear or branched alkyl group, Ph is a phenylene group, m is an integer of from 1 to 4, and r is an integer of from 1 to 6).