Fluoroalkyl Phosphonate Salt Coating Additive for Block Resistance

The patent changes the chemical structure parameter by replacing the phosphate group (P=O with P-O-C) with a phosphonate group (P(=O)(OR)2), where R is a C1-C6 alkyl group. This structural modification fundamentally alters the chemical properties: the phosphonate ester bonds are resistant to hydrolysis unlike phosphate esters, and the compound can be prepared in high purity through selective synthesis. This parameter change resolves both the manufacturing difficulty and the stability issues while maintaining block resistance performance.

The patent applies local quality by concentrating the fluorine atoms in a specific region (the perfluoroalkyl chain) while keeping the rest of the molecule (the phosphonate ester portion) composed of environmentally benign elements. The structure CF3(CF2)n-CH2-CH2-O-P(=O)(OR)2 places the hydrophobic, surface-active fluorinated tail separate from the hydrolytically stable, non-toxic phosphonate head group. This localized fluorination maintains excellent block resistance performance while reducing overall environmental harm compared to fully fluorinated compounds.

This principle is applied in reverse - instead of using unstable phosphate esters that require frequent replacement or reapplication, the patent employs phosphonate esters with P-O-C(alkyl) bonds that are inherently resistant to hydrolysis. The bond strength and chemical inertness of the phosphonate ester linkage create a durable, long-lasting surfactant that maintains its block resistance function over extended periods without degradation, eliminating the need for frequent reapplication.