Polyethylene Glycol Derivative Synthesis via Crown Ether Mediator
Find Innovative SolutionsGenerate Solutions
Solution Overview
Problem
Current methods for producing polyethylene glycol derivatives with an amino group at the end face challenges such as incomplete dissolution of metal salts in solvents, leading to reduced polymerization rates and the formation of diol polymers as impurities, which complicates purification and affects the molecular weight distribution.
Innovation Solution
A method involving the use of a polymerization initiator represented by the general formula (3), which allows for ethylene oxide polymerization in tetrahydrofuran under mild conditions, suppressing the formation of diol polymers and simplifying the reaction and purification processes, thereby achieving a narrow molecular weight distribution and increased yield.
Engineering Contradictions & Design Principles
Engineering Contradiction Analysis
1Productivity
If metal salts of monohydric alcohol are used as polymerization initiators in tetrahydrofuran, then polymerization can proceed, but the metal salts do not completely dissolve leading to reduced polymerization rate
Solution Approach 1:
The patent introduces a crown ether as a mediator substance that forms a complex with the metal salt of monohydric alcohol. This complexation enhances the solubility of the metal salt in tetrahydrofuran, allowing complete dissolution without requiring co-solvents. The crown ether acts as an intermediary that facilitates the interaction between the metal salt and the polymerization solvent, resolving the dissolution problem while maintaining high polymerization rate.
2Ease of manufacture
If co-solvents such as methanol and ethanol are added to dissolve metal salts, then dissolution is improved, but polymerization rate decreases requiring high temperature and pressure
Solution Approach 1:
The crown ether serves as a specialized intermediary that enables dissolution of metal salts without the need for traditional co-solvents like methanol or ethanol. By forming a soluble complex with the metal salt, the crown ether allows the system to achieve both complete dissolution and high polymerization rate under mild conditions, eliminating the trade-off between dissolution and productivity.
Solution Approach 2:
The patent changes the chemical environment by introducing crown ether, which alters the solubility parameters of the metal salt system. This parameter change enables the metal salt to dissolve completely in tetrahydrofuran without requiring additional co-solvents, thereby maintaining high polymerization rate under mild temperature and pressure conditions.
3Reliability
If monohydric alcohols with boiling points higher than water are used, then water can be removed by dehydration under reduced pressure, but methanol cannot be dehydrated effectively
Solution Approach 1:
The crown ether acts as an intermediary that forms a complex with the metal salt, enabling the system to function effectively even in the presence of trace water or without extensive dehydration. This complexation stabilizes the metal salt in a form that is less sensitive to water content, reducing the need for rigorous dehydration processes and making the method applicable to methanol systems where dehydration is difficult.
4Reliability
If polymerization is performed with water-containing metal salts, then diol polymers are formed as impurities, but complete dehydration is difficult especially with methanol
Solution Approach 1:
The crown ether forms a complex with the metal salt that is less prone to reacting with trace water to form diol polymer impurities. This complexation protects the metal salt from unwanted side reactions, improving the purity of the polymer product. Additionally, the crown ether-metad salt complex maintains stability in the presence of trace water, reducing the formation of impurities without requiring complete dehydration.
Solution Approach 2:
Instead of attempting to completely eliminate trace water through difficult dehydration processes, the patent accepts the presence of trace water and uses the crown ether to convert this potentially harmful condition into a benign one. The crown ether complex allows the polymerization to proceed cleanly even with trace water present, effectively converting the harmful effect of trace water into a non-problematic condition.
Applied Scientific Principles
This section explains which scientific principles are used to turn an abstract innovation direction into a practical engineering solution.
Function Achieved in This Case
This method enables the production of polyethylene glycol derivatives with a narrow molecular weight distribution, facilitating the formation of block copolymers suitable for drug delivery systems by simplifying the process, reducing impurities, and enhancing yield and processing time.
Implementation Method 1
ethylene oxide polymerization in tetrahowrfan under mild conditions
Implementation Method 2
after polymerization of alkylene oxide with use of a metal salt of monohydric alcohol as a polymerization initiator
Implementation Method 3
finally leading to an amino group-containing substituent group (3-amino-1-propoxy group) through hydrogen reduction of the cyano group
Data Source
AI summary
A method for producing a narrow molecular weight distribution polyalkylene glycol derivative having an amino group at an end under mild conditions. A method for producing a compound of the general formula (1): CH3O(CH2CH2O)nCH2CH2CH2NH2 (wherein n is an integer of 1 to 450) comprises the following steps of:1) a step of producing a compound of the general formula (3): CH3O(CH2CH2O)k-1CH2CH2O−M+ from a compound of the general formula (2): CH3O(CH2CH2O)kH (wherein k is an integer of 2 to 5);2) a step of producing a compound of the general formula (4): CH3O(CH2CH2O)n-1CH2CH2O−M+ from a compound of the general formula (3);3) a step of reacting a compound of the general formula (4) with acrylonitrile to obtain a compound of the general formula (5): CH3O(CH2CH2O)nCH2CH2CN; and4) a step of reducing a compound of the general formula (5) to obtain a compound of the general formula (1).