Polyfluoro-1-alkene Synthesis for Biodegradable Surface Coatings
Find Innovative SolutionsGenerate Solutions
Solution Overview
Problem
Current polyfluoro-1-alkenes with perfluoroalkyl groups containing 8 or more carbon atoms are biologically degraded and cause environmental concerns, while those with 6 or less carbon atoms lack sufficient performance due to lower melting and glass transition points, making them unsuitable for durable surface treatments.
Innovation Solution
A polyfluoro-1-alkene with a perfluoroalkyl group containing 5 or less CF2 groups is produced by reacting a polyfluoroalkyl iodide with an inorganic or nitrogen-containing organic basic compound, allowing for easy decomposition and avoiding the formation of environmentally harmful perfluorooctanoic acids, and is used as a copolymerizable monomer for fluorine-containing copolymers.
Engineering Contradictions & Design Principles
Engineering Contradiction Analysis
1Reliability
If telomer compounds with C8-C12 perfluoroalkyl group are used to improve surface modification properties and water-oil repellency, then desired performance is achieved, but biodegradation leads to high bioaccumulative compounds and environmental concentration
Solution Approach 1:
The patent changes the carbon chain length parameter from C8-C12 to C4-C6 perfluoroalkyl groups, which fundamentally alters the degradation behavior and eliminates bioaccumulative compound formation while maintaining adequate surface treatment performance
Solution Approach 2:
The patent employs shorter-lived, easily biodegradable perfluoroalkyl compounds (C4-C6) that decompose rapidly in the environment, preventing long-term bioaccumulation while still providing the needed surface modification functionality during their active service life
2Object-generated harmful factors
If telomer compounds with C6 or less perfluoroalkyl group are used to reduce bioaccumulation, then environmental safety is improved, but orientation on substrate surface and thermal properties markedly decrease
Solution Approach 1:
The patent optimizes the perfluoroalkyl chain length to a specific range (C4-C6 with controlled CF2 group succession) and adjusts the balance between fluorinated and hydrocarbon segments to achieve adequate surface orientation while maintaining environmental safety
Solution Approach 2:
The patent creates composite molecular structures combining perfluoroalkyl groups with hydrocarbon chains in specific ratios, where the hydrocarbon portion provides sufficient van der Waals interactions for surface orientation while the perfluoroalkyl portion ensures environmental safety
3Object-generated harmful factors
If telomer compounds with C6 or less perfluoroalkyl group are used to avoid perfluorooctanoic acid generation, then environmental loading is reduced, but melting point and glass transition point are markedly lower
Solution Approach 1:
The patent adjusts the molecular weight and chain structure parameters by incorporating longer hydrocarbon chains alongside shorter perfluoroalkyl groups, compensating for the reduced thermal properties through increased van der Waals interactions in the hydrocarbon segments
Applied Scientific Principles
This section explains which scientific principles are used to turn an abstract innovation direction into a practical engineering solution.
Function Achieved in This Case
The resulting polyfluoro-1-alkene enhances surface modification, water- and oil-repellency, and mold-release properties while being environmentally friendly, with excellent light transmittance and chemical resistance in fluorine-containing copolymers for various applications.
Implementation Method 1
reacting a polyfluoroalkyl iodide with an inorganic or nitrogen-containing organic basic compound
Implementation Method 2
reacting a polyfluoroalkyl iodide with an inorganic basic compound in the presence of a phase transfer catalyst
Data Source
AI summary
A polyfluoro-1-alkene represented by the general formula: CF3(CF2)nCH2(CF2)mCH=CH2 [I], wherein n is an integer of 0 to 5, and m is an integer of 1 to 7, is produced by reacting a polyfluoroalkyl iodide represented by the general formula: CF3(CF2)nCH2(CF2)m(CH2CH2)I [II], wherein n is an integer of 0 to 5, and m is an integer of 1 to 7, with an inorganic basic compound in the presence of a phase transfer catalyst. Alternatively, the polyfluoro-1-alkene is produced by reacting the polyfluoroalkyl iodide [II] with a nitrogen-containing organic basic compound, and is obtained product [I] as one fraction thereof. By the copolymerization of the polyfluoro-1-alkene with other fluorinated olefin monomers, a fluorine-containing copolymer having excellent light transmittance in the visible light range is formed.