Polyfluoroalkylphosphonic Acid Esters for Mold Release
Find Innovative SolutionsGenerate Solutions
Solution Overview
Problem
Polyfluoroalkylphosphonic acid esters with perfluoroalkyl groups containing 6 or less carbon atoms face bioaccumulation and environmental concerns, and their shorter counterparts lack durability and performance as mold-releasing agents or lubricating oil additives due to low melting points and surface orientation issues.
Innovation Solution
A process producing polyfluoroalkylphosphonic acid esters through the reaction of polyfluoro-1-alkenes with dialkyl phosphites in the presence of an organic peroxide, resulting in compounds with a perfluoroalkyl group structure that undergoes easy decomposition and has low bioaccumulation potential, avoiding the generation of perfluorooctanoic acids.
Engineering Contradictions & Design Principles
Engineering Contradiction Analysis
1Reliability
If telomer compounds with C8-C12 perfluoroalkyl group are used as mold-releasing agents, then mold release performance is improved, but bioaccumulation potential and environmental concentration increase
Solution Approach 1:
The patent changes the carbon atom parameter of the perfluoroalkyl group from 8-12 atoms to 6 or fewer atoms. This parameter change maintains the essential mold release performance while reducing the chain length that causes bioaccumulation. The specific structure CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)P(O)(OR)2 with n≤6 achieves this balance by limiting the perfluoroalkyl chain length.
2Reliability
If telomer compounds with C8-C12 perfluoroalkyl group are produced, then mold release performance is achieved, but perfluorooctanoic acids are generated and incorporated during production
Solution Approach 1:
The patent extracts or removes the problematic C8-C12 perfluoroalkyl group structure that leads to perfluorooctanoic acid generation. By replacing it with a C6 or fewer perfluoroalkyl group in the specified molecular structure, the production process no longer generates perfluorooctanoic acids while maintaining the desired functional performance.
3Object-generated harmful factors
If compounds with perfluoroalkyl group containing 6 or less carbon atoms are used, then bioaccumulation potential is reduced, but orientation on substrate surface and thermal properties decrease
Solution Approach 1:
The patent creates a composite molecular structure that combines a short perfluoroalkyl group (C6 or fewer) with specific structural components: (CH2CF2)a units that provide flexibility and orientation capability, and P(O)(OR)2 groups that enhance thermal properties. This composite structure compensates for the reduced chain length effects while maintaining low bioaccumulation potential.
Solution Approach 2:
The patent applies local quality by concentrating the functional properties in specific molecular regions. The perfluoroalkyl group provides the low bioaccumulation characteristic, while the (CH2CF2)a segment and P(O)(OR)2 group locally provide the necessary surface orientation and thermal stability, respectively. Each part of the molecule has a specialized function that compensates for the overall shorter chain length.
4Object-generated harmful factors
If compounds with perfluoroalkyl group containing 6 or less carbon atoms are used, then environmental safety is improved, but durability and performance are affected due to lower melting point and glass transition point
Solution Approach 1:
The patent changes the molecular structure parameters to compensate for the lower melting point and glass transition point. By optimizing the values of n, a, and b in the structure CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)P(O)(OR)2, the compound achieves adequate thermal properties for durability while maintaining n≤6 for environmental safety.
Solution Approach 2:
The patent uses a composite molecular architecture where the combination of perfluoroalkyl group, (CH2CF2)a units, and P(O)(OR)2 group creates synergistic effects. The P(O)(OR)2 group specifically contributes to thermal stability and durability, compensating for the reduced thermal properties that would result from using a shorter perfluoroalkyl chain.
Applied Scientific Principles
This section explains which scientific principles are used to turn an abstract innovation direction into a practical engineering solution.
Function Achieved in This Case
The resulting polyfluoroalkylphosphonic acid esters exhibit reduced environmental impact, maintain performance as mold-releasing agents, and function effectively as lubricating oil additives with improved durability and stability.
Implementation Method 1
reacting a polyfluoro-1-alkene represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)bCH=CH2 with a dialkyl phosphite represented by the general formula: (RO)2P(O)H, in an addition reaction
Implementation Method 2
The addition reaction is carried out in the presence of an organic peroxide
Data Source
AI summary
A polyfluoroalkylphosphonic acid ester represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cP(O)(OR)2 (R is an alkyl group having 1 to 4 carbon atoms, n is an integer of 1 to 6, a is an integer of 1 to 4, b is an integer of 1 to 3, and c is an integer of 1 to 3) is produced by a process of reacting a polyfluoroalkyl iodide represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cI with a trialkyl phosphite represented by the general formula: P(OR)3 or by a process of reacting a polyfluoro-1-alkene represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)bCH=CH2 with a dialkyl phosphite represented by the general formula: (RO)2P(O)H.