Polyfluoroalkylphosphonic Acid Ester Synthesis for Mold Release
Find Innovative SolutionsGenerate Solutions
Solution Overview
Problem
Polyfluoroalkylphosphonic acid esters with perfluoroalkyl groups containing 6 or less carbon atoms face challenges due to high bioaccumulation potential and environmental concerns, leading to decreased performance and durability as mold-releasing agents or lubricating oil additives, while compounds with more carbon atoms are difficult to handle and produce environmentally harmful by-products.
Innovation Solution
A polyfluoroalkylphosphonic acid ester with a perfluoroalkyl group containing 6 or less carbon atoms is synthesized using a process involving polyfluoroalkyl iodides and trialkyl phosphites or polyfluoro-1-alkenes with dialkyl phosphites, which reduces bioaccumulation potential and avoids the production of harmful by-products, and is designed for use as a mold-releasing agent or lubricating oil additive.
Engineering Contradictions & Design Principles
Engineering Contradiction Analysis
1Reliability
If polyfluoroalkylphosphonic acid esters with perfluoroalkyl groups containing 8 or more carbon atoms are used, then mold release performance and durability are improved, but bioaccumulation potential increases and environmental harm worsens
Solution Approach 1:
The patent changes the carbon atom parameter of the perfluoroalkyl group from 8 or more to 6 or less, transforming the molecular structure to reduce bioaccumulation potential while maintaining the essential functional properties for mold release performance
Solution Approach 2:
The patent modifies specific local regions of the molecule by controlling the distribution of CF2 and CH2 groups within the perfluoroalkyl chain, maintaining functional performance while reducing overall bioaccumulation risk
2Object-affected harmful factors
If polyfluoroalkylphosphonic acid esters with perfluoroalkyl groups containing 6 or less carbon atoms are used, then bioaccumulation potential is reduced, but mold release performance and durability decrease
Solution Approach 1:
The patent optimizes the carbon atom parameter to exactly 6 or fewer, and adjusts the structural parameters (a, b, c values) to maximize molecular orientation and interaction with mold surfaces, compensating for the reduced chain length
Solution Approach 2:
The patent creates a composite molecular structure combining perfluoroalkyl groups with phosphonic acid ester moieties, where the synergistic interaction between these functional groups enhances adhesion and mold release performance despite the shorter carbon chain
3Reliability
If polyfluoroalkylphosphonic acid esters with perfluoroalkyl groups containing 14 or more carbon atoms are used, then mold release performance is enhanced, but handling difficulty and production complexity increase
Solution Approach 1:
The patent reduces the carbon atom parameter from 14 or more to 6 or less, fundamentally changing the physical properties of the compound to improve volatility, handling characteristics, and production feasibility while retaining essential functional performance
4Productivity
If telomer compounds with perfluoroalkyl groups containing 8 or more carbon atoms are produced, then production yield is achieved, but perfluorooctanoic acid by-products are generated
Solution Approach 1:
The patent changes the carbon atom parameter of the perfluoroalkyl group to 6 or fewer, which fundamentally alters the degradation pathway and prevents the formation of perfluorooctanoic acid by-products, eliminating the environmental harm while maintaining production efficiency
Applied Scientific Principles
This section explains which scientific principles are used to turn an abstract innovation direction into a practical engineering solution.
Function Achieved in This Case
The resulting ester has low environmental impact, is effectively decomposed, and maintains performance as a mold-releasing agent or lubricating oil additive, addressing bioaccumulation concerns and environmental hazards associated with previous compounds.
Implementation Method 1
When released into the environment, the polyfluoroalkylphosphonic acid ester of the present invention undergoes HF-elimination in the —CH2CF2— bonding site of the molecule, and a double bond is formed.
Data Source
AI summary
A polyfluoroalkylphosphonic acid ester represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cP(O)(OR)2 (R is an alkyl group having 1 to 4 carbon atoms, n is an integer of 1 to 6, a is an integer of 1 to 4, b is an integer of 1 to 3, and c is an integer of 1 to 3) is produced by a process of reacting a polyfluoroalkyl iodide represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cI with a trialkyl phosphite represented by the general formula: P(OR)3 or by a process of reacting a polyfluoro-1-alkene represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)bCH═CH2 with a dialkyl phosphite represented by the general formula: (RO)2P(O)H.