Immunogenic compositions comprising conjugated capsular saccharide antigens and uses thereof

WO2025186705A8PCT designated stage Publication Date: 2025-10-02PFIZER INC
View PDF 0 Cites 0 Cited by

Patent Information

Application Number
PCT/IB2025/052302
Authority / Receiving Office
WO · WO
Patent Type
Applications
Current Assignee / Owner
Priority Date
2025-02-06
Filing Date
2025-03-03
Publication Date
2025-10-02

AI Technical Summary

Technical Problem

Existing vaccines for Streptococcus pneumoniae serotype 9N struggle to induce a robust immune response due to the viscosity of its polysaccharide chains, making it difficult to handle and conjugate effectively with carrier proteins.

Method used

Development of Streptococcus pneumoniae serotype 9N glycoconjugates through covalent or non-covalent bonding of capsular saccharides to carrier proteins, utilizing chemical and mechanical sizing to achieve improved immunogenicity and better conjugation yields.

Benefits of technology

The glycoconjugates generate a more robust immune response and are produced with fewer operational steps, enhancing vaccine efficacy against pneumococcal infections.

✦ Generated by Eureka AI based on patent content.
Patent Text Reader

Abstract

The present invention relates to new conjugated capsular saccharide antigens (glycoconjugates), immunogenic compositions comprising said glycoconjugates and uses thereof.
Need to check novelty before this filing date? Find Prior Art

Description

PC073064A Immunogenic compositions comprising conjugated capsular saccharide antigens and uses thereof Field of the Invention The present invention relates to new conjugated capsular saccharide antigens (glycoconjugates), immunogenic compositions comprising said glycoconjugates and uses thereof. Immunogenic compositions of the present invention will typically comprise glycoconjugates, wherein the saccharides are derived from serotypes of Streptococcus pneumoniae. The invention also relates to vaccination of human subjects, in particular infants and elderly, against pneumoccocal infections using said glycoconjugates. More particularly, the invention relates to Streptococcus pneumoniae serotype 9N glycoconjugates and immunogenic composition comprising a Streptococcus pneumoniae serotype 9N glycoconjugate. The Streptococcus pneumoniae serotype 9N glycoconjugates of the invention can be used as a vaccine. Background of the Invention Infections caused by pneumococci are a major cause of morbidity and mortality all over the world. Pneumonia, febrile bacteraemia and meningitis are the most common manifestations of invasive pneumococcal disease, whereas bacterial spread within the respiratory tract may result in middle-ear infection, sinusitis or recurrent bronchitis. Compared with invasive disease, the non-invasive manifestations are usually less severe, but considerably more common. The etiological agent of pneumococcal diseases, Streptococcus pneumoniae (pneumococcus), is a Gram-positive encapsulated coccus, surrounded by a polysaccharide capsule. Differences in the composition of this capsule permit serological differentiation between about 91 capsular types, some of which are frequently associated with pneumococcal disease, others rarely. Invasive pneumococcal infections include pneumonia, meningitis and febrile bacteraemia; among the common non-invasive manifestations are otitis media, sinusitis and bronchitis. Pneumococcal polysaccharides, in particular capsular polysaccharides, are important immunogens found on the surface of the bacteria. This has led to them being an important component in the design of pneumococcal vaccines. They have proved useful in eliciting immune responses especially when linked to carrier proteins. Some serotypes, in particular Streptococcus pneumoniae serotype 9N, produce large and viscous polysaccharide chains. Its viscosity has made it difficult to handle. Thus, there is a need for antigens which are able to generate a more robust immune response to Streptococcus pneumoniae serotype 9N.The present invention provides in particular Streptococcus pneumoniae serotype 9N glycoconjugates which show improved immunogenicity. The present invention also provides processes which generate Streptococcus pneumoniae serotype 9N glycoconjugates with fewer operational steps, and better conjugation yields. Figures Figure 1 shows a repeating polysaccharide structure of the S. pneumoniae serotype 9N capsular polysaccharide. Figure 2 shows opsonophagocytic activity (OPA) titers for S. pneumoniae serotype 9N conjugates in mice. Different chemistries (Reductive Amination in DMSO or click chemistry (Click)) and polysaccharides of different size have been used. Figure 3 shows opsonophagocytic activity (OPA) titers for S. pneumoniae serotype 9N conjugates in mice. Conjugates with different attributes have been used. The present invention is directed in part to conjugated capsular saccharide antigens (also named glycoconjugates). For the purpose of the invention the term ‘glycoconjugate' indicates a capsular saccharide conjugated to a carrier protein via covalent or non-covalent bonds. In an embodiment, the capsular saccharide is conjugated to a carrier protein via non-covalent bonds. Preferably, the capsular saccharide is conjugated via covalent bonds. In one embodiment the capsular saccharide is conjugated directly to a carrier protein. In a second embodiment the capsular saccharide is conjugated to a carrier protein through a spacer / linker. 1. Capsular Streptococcus pneumoniae serotype 9N saccharide of the invention The structure of Streptococcus pneumoniae serotype 9N polysaccharide is known in the art. The polysaccharide repeating unit of serotype 9N consists of a pentasaccharide unit (see e.g. Geno K et al. (2015) Clin Microbiol Rev Vol 28:3, p 871-899): [→ 4)-α-D-GlcpA-(1→3)-α-D-Glcp-(1→3)-β-D-ManpNAc-(1→4)-β-D-Glcp-(1→ 4)-α-D- GlcpNAc-(1→]nThe term "saccharide" throughout this specification may indicate polysaccharide or oligosaccharide and includes both. In frequent embodiments, the saccharide is a polysaccharide, in particular a S. pneumoniae capsular polysaccharide. In an embodiment, the capsular S. pneumoniae serotype 9N saccharide used in the present invention is an oligosaccharide. Oligosaccharides have a low number of repeat units (typically 5- 15 repeat units) and are typically derived synthetically or by hydrolysis of polysaccharides. In an embodiment, the capsular S. pneumoniae serotype 9N saccharide used in the present invention is a synthetic carbohydrate. In a preferred embodiment though, the source of bacterial capsular saccharide according to this invention can be Streptococcus pneumoniae serotype 9N bacterial cells. Bacterial strainswhich can be used as source of S. pneumoniae serotype 9N polysaccharides may be obtained from established culture collections (such as for example from the Streptococcal Reference Laboratory (Centers for Disease Control and Prevention, Atlanta, GA USA)) or clinical specimens. Capsular S. pneumoniae serotype 9N saccharide can be obtained directly from bacteria using isolation procedures known to one of ordinary skill in the art (see for example methods disclosed in US2006 / 0228380, US2006 / 0228381, US2007 / 0184071, US2007 / 0184072, US2007 / 0231340, and US2008 / 0102498 and WO2008 / 118752). They can also be purchased (such as for example from the American Type Culture Collection (ATCC, Manassas, VA USA) (e.g., reference No. ATCC 192-X or ATCC 21-X)). In case the capsular S. pneumoniae serotype 9N saccharide is obtained directly from bacteria, the bacterial cells can be grown in a medium, preferably in a soy based medium. Following fermentation of bacterial cells that produce S. pneumoniae serotype 9N capsular saccharides, the bacterial cells can be lysed to produce a cell lysate. The capsular S. pneumoniae serotype 9N saccharide may then be isolated from the cell lysate using purification techniques known in the art, including the use of centrifugation, depth filtration, precipitation, ultra-filtration, treatment with activate carbon, diafiltration and / or column chromatography (see, for example, US2006 / 0228380, US2006 / 0228381 and WO2008 / 118752). The isolated capsular S. pneumoniae serotype 9N saccharide can then be used for the preparation of immunogenic conjugates. As used herein, the term "isolated" in connection with a saccharide refers to isolation of S. pneumoniae serotype specific capsular saccharide from purified saccharide using purification techniques known in the art, including the use of centrifugation, depth filtration, precipitation, ultrafiltration, treatment with activate carbon, diafiltration and / or column chromatography. Generally, an isolated saccharide refers to partial removal of proteins, nucleic acids and non- specific endogenous polysaccharide (C-polysaccharide). The isolated saccharide contains less than 10%, 8%, 6%, 4%, or 2% protein impurities and / or nucleic acids. The isolated saccharide contains less than 20% of C-polysaccharide with respect to type specific saccharides. The isolated capsular S. pneumoniae serotype 9N saccharide obtained by purification from the S. pneumoniae lysate can be characterized by different parameters including, for example the weight average molecular weight (Mw). The molecular weight of the saccharide can be measured by Size Exclusion Chromatography (SEC) combined with Multiangle Laser Light Scattering detector (MALLS). In an embodiment, the isolated capsular S. pneumoniae serotype 9N saccharide (i.e. purified before further treatment) has a weight average molecular weight between 5 kDa and 5,000 kDa. In an embodiment, the isolated capsular S. pneumoniae serotype 9N polysaccharide has a weight average molecular weight between 100 kDa and 4,000 kDa. In a preferred embodiment, the isolated capsular polysaccharide has a weight average molecular weightbetween 500 kDa and 2,000 kDa. In an even preferred embodiment, the isolated capsular polysaccharide has a weight average molecular weight between 500 kDa and 1,000 kDa. The capsular Streptococcus pneumoniae serotype 9N saccharides of the invention may be sized and / or activated (e.g., chemically activated) to make them capable of reacting (e.g., either directly to the carrier protein of via a linker) and then incorporated into glycoconjugates of the invention, as further described herein. 2. S. pneumoniae serotype 9N glycoconjugates of the invention For the purpose of the invention the term ‘glycoconjugate' indicates a capsular saccharide conjugated to a carrier protein via covalent or non-covalent bonds. In an embodiment, the capsular saccharide is conjugated to a carrier protein via non-covalent bonds (such as the rhizavidin / biotin system, see e.g. WO2012155007, WO2020056202). Preferably, the capsular saccharide is conjugated via covalent bonds. In one embodiment the capsular saccharide is conjugated directly to a carrier protein. In a second embodiment the capsular saccharide is conjugated to a carrier protein through a spacer / linker. The present invention provides glycoconjugates in which saccharides as provided for above are conjugated to a carrier protein. Therefore, in an embodiment, the invention provides a glycoconjugate comprising a saccharide having the above disclosed repeating unit conjugated to a carrier protein. In an embodiment, the invention provides a glycoconjugate consisting of a saccharide having the above disclosed repeating unit conjugated to a carrier protein. 2.1 Attributes of the S. pneumoniae serotype 9N glycoconjugates of the invention The serotype 9N saccharide described above may be activated (e.g., chemically activated) to make them capable of reacting (e.g. with a linker or directly with the carrier protein) and then incorporated into glycoconjugates, as further described herein. In order to generate serotype 9N conjugates with advantageous filterability characteristics and / or yields, sizing of polysaccharide to a target molecular weight range may be performed prior to the conjugation to a carrier protein. Advantageously, the size of isolated serotype 9N polysaccharide is reduced while preserving critical features of the structure of the polysaccharide. mechanical or chemical sizing maybe employed. In an embodiment, the size of isolated serotype 9N polysaccharide is reduced by chemical hydrolysis. Chemical hydrolysis maybe conducted using a mild acid (e.g acetic acid, formic acid, propanoic acid). In an embodiement, chemical hydrolysis is conducted using formic acid. In an embodiement, chemical hydrolysis is conducted using propanoic acid. In a preferred embodiement, chemical hydrolysis is conducted using acetic acid. In an embodiement, chemical hydrolysis is conducted in acetic acid at 0.15-0.25 M. In a preferred embodiement, chemical hydrolysis is conducted in acetic acid at about 0.2 M. In an embodiement, chemical hydrolysis is conducted in acetic acid at 0.15-0.25 M, at a temperature of 80 to 90 ºC. In a preferredembodiement, chemical hydrolysis is conducted in acetic acid at about 0.2 M at a temperature of about 85ºC for 3 to 7 h. In a preferred embodiement, chemical hydrolysis is conducted in acetic acid at about 0.2 M at a temperature of about 85ºC for about 5h. Chemical hydrolysis may also be conducted using a diluted strong acid (such as diluted hydrochloric acid, diluted sulfuric acid, diluted phosphoric acid, diluted nitric acid or diluted perchloric acid). In an embodiement, chemical hydrolysis is conducted using diluted hydrochloric acid. In an embodiement, chemical hydrolysis is conducted using diluted sulfuric acid. In an embodiement, chemical hydrolysis is conducted using diluted phosphoric acid. In an embodiement, chemical hydrolysis is conducted using diluted nitric acid. In an embodiement, chemical hydrolysis is conducted using diluted perchloric acid. The size of isolated serotype 9N polysaccharide can also be reduced by mechanical homogenization. In an embodiment, the size of isolated serotype 9N polysaccharide is reduced by high pressure homogenization. High pressure homogenization achieves high shear rates by pumping the process stream through a flow path with sufficiently small dimensions. The shear rate is increased by using a larger applied homogenization pressure, and exposure time can be increased by recirculating the feed stream through the homogenizer. The high-pressure homogenization process can be appropriate for reducing the size of isolated serotype 9N polysaccharide while preserving the structural features of the polysaccharide. In an embodiment, the isolated serotype 9N capsular polysaccharide is sized to a weight average molecular weight between 5 kDa and 500 kDa. In an embodiment, the isolated serotype 9N capsular polysaccharide is sized to a weight average molecular weight between 50 kDa and 450 kDa. In a preferred embodiment, the isolated serotype 9N capsular polysaccharide is sized to a weight average molecular weight between 100 kDa and 400 kDa. In an embodiment, the isolated serotype 9N capsular polysaccharide is sized to a weight average molecular weight of between about 200 kDa and about 300 kDa. In an embodiment, the isolated serotype 9N capsular polysaccharide is sized to a weight average molecular weight of between about 100 kDa and about 200 kDa. In an embodiment, the isolated serotype 9N capsular polysaccharide is not sized. In a preferred embodiment, the capsular S. pneumoniae serotype 9N saccharide used in the present invention is a polysaccharide. High molecular weight capsular polysaccharides are able to induce certain antibody immune responses due to the epitopes present on the antigenic surface. The isolation and purification of high molecular weight capsular polysaccharides is preferably contemplated for use in the conjugates, compositions and methods of the present invention. In an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 50 kDa and 1,000 kDa. Preferably, the weight average molecular weight (Mw) is between 100 kDa and 800 kDa.The weight average molecular weight (Mw) of the serotype 9N saccharide before conjugation refers to the Mw before the activation of the serotype 9N polysaccharide (i.e. after an eventual sizing step but before reacting the polysaccharide with an activating agent). In the context of the present invention the Mw of the serotype 9N polysaccharide is not substantially modified by the activation step and the Mw of the serotype 9N polysaccharide incorporated in the conjugate is similar to the Mw of the polysaccharide as measured before activation. In an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 150kDa and 650 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 200 kDa and 500 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 200 kDa and 400 kDa. In some embodiments, the serotype 9N glycoconjugate of the invention has a weight average molecular weight (Mw) of between 250 kDa and 20,000 kDa. In other embodiments, the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 500 kDa and 15,000 kDa. In yet other embodiments, the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 500 kDa and 10,000 kDa. Preferably, the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 500 kDa and 5,000 kDa. In an embodiment, the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 800 kDa and 8,000 kDa. In an embodiment, the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 800 kDa and 6,000 kDa. In an embodiment, the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1000 kDa and 5,000 kDa. In an embodiment, the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,500 kDa and 4,500 kDa. The molecular weight of the glycoconjugate can be measured by Size Exclusion Chromatography (SEC) combined with Multiangle Laser Light Scattering detector (MALLS). Another way to characterize the serotype 9N glycoconjugates of the invention is by the number of lysine residues in the carrier protein (e.g., CRM197, SCP, DT or TT) that become conjugated to the saccharide which can be characterized as a range of conjugated lysines (degree of conjugation). The evidence for lysine modification of the carrier protein, due to covalent linkages to the polysaccharides, can be obtained by amino acid analysis using routine methods known to those of skill in the art. Conjugation results in a reduction in the number of lysine residues recovered compared to an embodiment, the degree of conjugation of the serotype 9Nglycoconjugate of the invention is between 2 and 15. In a preferred embodiment, the degree of conjugation of the serotype 9N glycoconjugate of the invention is between 4 and 12. In a very preferred embodiment, the degree of conjugation of the serotype 9N glycoconjugate of the invention is between 4 and 7. In some such embodiments, the carrier protein is CRM197. In other such embodiments, the carrier protein is SCP. The serotype 9N glycoconjugates of the invention may also be characterized by the ratio (weight / weight) of saccharide to carrier protein. In some embodiments, the ratio of serotype 9N polysaccharide to carrier protein in the glycoconjugate (w / w) is between 0.5 and 3.0. In other embodiments, the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.5. In a preferred embodiment, the ratio of serotype 9N capsular polysaccharide to carrier protein in the conjugate is between 0.8 and 1.2. The serotype 9N glycoconjugates of the invention may also be characterized by the number of covalent linkages between the carrier protein and the saccharide as a function of repeat units of the saccharide. In one embodiment, the serotype 9N glycoconjugate of the invention comprises at least one covalent linkage between the carrier protein and the polysaccharide for every 4 saccharide repeat units of the polysaccharide. In another embodiment, the covalent linkage between the carrier protein and the polysaccharide occurs at least once in every 10 saccharide repeat units of the polysaccharide. In another embodiment, the covalent linkage between the carrier protein and the polysaccharide occurs at least once in every 15 saccharide repeat units of the polysaccharide. In a further embodiment, the covalent linkage between the carrier protein and the polysaccharide occurs at least once in every 25 saccharide repeat units of the polysaccharide. In a further embodiment, the covalent linkage between the carrier protein and the polysaccharide occurs at least once in every 50 saccharide repeat units of the polysaccharide. In yet a further embodiment, the covalent linkage between the carrier protein and the polysaccharide occurs at least once in every 100 saccharide repeat units of the polysaccharide. In other embodiments, the serotype 9N glycoconjugate of the invention comprises at least one covalent linkage between the carrier protein and the polysaccharide for every 5 to 30 saccharide repeat units of the polysaccharide. In other embodiments, the serotype 9N glycoconjugate of the invention comprises at least one covalent linkage between the carrier protein and the polysaccharide for every 10 to 20 saccharide repeat units of the polysaccharide. In some embodiments, the carrier protein is CRM197and the covalent linkage between the CRM197and the polysaccharide occurs at least once in every 4, 10, 15 or 25 saccharide repeat units of the polysaccharide. In frequent embodiments, the carrier protein is SCP and the covalent linkage between the SCP and the polysaccharide occurs at least once in every 4, 10, 15 or 25 saccharide repeat units of the polysaccharide. The serotype 9N glycoconjugates and immunogenic compositions of the invention may contain free saccharide that is not covalently conjugated to the carrier protein but is neverthelesspresent in the glycoconjugate composition. The free saccharide may be noncovalently associated with (i.e., noncovalently bound to, adsorbed to, or entrapped in or with) the glycoconjugate. In a preferred embodiment, the serotype 9N glycoconjugate comprises less than about 50% of free serotype 9N polysaccharide compared to the total amount of serotype 9N polysaccharide. In a preferred embodiment the serotype 9N glycoconjugate comprises less than about 40% of free serotype 9N polysaccharide compared to the total amount of serotype 9N polysaccharide. In a yet preferred embodiment, the serotype 9N glycoconjugate comprises less than about 25% of free serotype 9N polysaccharide compared to the total amount of serotype 9N polysaccharide. In an even preferred embodiment, the serotype 9N glycoconjugate comprises less than about 20% of free serotype 9N polysaccharide compared to the total amount of serotype 9N polysaccharide. In a yet preferred embodiment, the serotype 9N glycoconjugate comprises less than about 15% of free serotype 9N polysaccharide compared to the total amount of serotype 9N polysaccharide. The serotype 9N glycoconjugates may also be characterized by their molecular size distribution (Kd). Size exclusion chromatography media (CL-4B) can be used to determine the relative molecular size distribution of the conjugate. Size Exclusion Chromatography (SEC) is used in gravity fed columns to profile the molecular size distribution of conjugates. Large molecules excluded from the pores in the media elute more quickly than small molecules. Fraction collectors are used to collect the column eluate. The fractions are tested colorimetrically by saccharide assay. For the determination of Kd, columns are calibrated to establish the fraction at which molecules are fully excluded (V0), (Kd=0), and the fraction representing the maximum retention (Vi), (Kd=1). The fraction at which a specified sample attribute is reached (Ve), is related to Kdby the expression, Kd= (Ve- V0) / (Vi- V0). In a preferred embodiment, at least 30% of the serotype 9N glycoconjugate has a Kdbelow or equal to 0.3 in a CL-4B column. In a preferred embodiment, at least 40% of the glycoconjugate has a Kdbelow or equal to 0.3 in a CL-4B column. In a preferred embodiment, at least 45%, 50%, 55%, 60%, 65%, 70%, 75%, 80%, or 85% of the serotype 9N glycoconjugate has a Kdbelow or equal to 0.3 in a CL-4B column. In a preferred embodiment, at least 60% of the serotype 9N glycoconjugate has a Kdbelow or equal to 0.3 in a CL-4B column. In a preferred embodiment, between 50% and 80% of the serotype 9N glycoconjugate has a Kdbelow or equal to 0.3 in a CL- 4B column. In a preferred embodiment, between 65% and 80% of the serotype 9N glycoconjugate has a Kdbelow or equal to 0.3 in a CL-4B column. 2.2 Mode of preparation of the Streptococcus pneumoniae serotype 9N glycoconjugates of the invention The serotype 9N glycoconjugate of the present invention can be prepared by any coupling technique known to those of ordinary skill in the art.In an embodiment, the serotype 9N saccharide is coupled to the carrier protein via non- covalent bonds (see e.g. WO2012155007, WO2020056202). In a preferred embodiment, the serotype 9N saccharide is conjugated via covalent bonds. In one embodiment the capsular saccharide is conjugated directly to a carrier protein. In a second embodiment the capsular saccharide is conjugated to a carrier protein through a spacer / linker. ln an embodiment, the serotype 9N glycoconjugate of the present invention is conjugated to the carrier protein via a linker, for instance a bifunctional linker. The linker is optionally heterobifunctional or homobifunctional, having for example a reactive amino group and a reactive carboxylic acid group, two reactive amino groups or two reactive carboxylic acid groups. The linker has for example between 4 and 20, 4 and 12, 5 and 10 carbon atoms. A possible linker is adipic acid dihydrazide (ADH). Other linkers include B-propionamido (WO 00 / 10599), nitrophenyl-ethylamine (Gever et al (1979) Med. Microbiol. lmmunol.165; 171- 288), haloalkyl halides (US4057685), glycosidic linkages (US4673574, US4808700), hexane diamine and 6-aminocaproic acid (US4459286). ln an embodiment, the serotype 9N glycoconjugate of the present invention is conjugated directly to the carrier protein (without a linker). ln general the following types of chemical groups on a protein carrier can be used for coupling / conjugation: 1) Amino group (for instance via lysine). ln one embodiment this group is linked to carboxyl groups on saccharides directly or to a carboxyl group on a linker with carbodiimide chemistry e.g. with EDAC (1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide). ln another embodiment this group is linked to hydroxyl groups activated with CDAP or CNBr on saccharides directly or to such groups on a linker; to saccharides or linkers having an aldehyde group; to saccharides or linkers having a succinimide ester group. 2) Carboxyl (for instance via aspartic acid or glutamic acid). ln one embodiment this group is linked to amino groups on saccharides directly or to an amino group on a linker with carbodiimide chemistry e.g. with EDAC. 3) Sulphydryl (for instance via cysteine). ln one embodiment this group is linked to a bromo or chloro acetylated saccharide or linker with maleimide chemistry. ln one embodiment this group is activated / modified with bis diazobenzidine. 4) Hydroxyl group (for instance via tyrosine). ln one embodiment this group is activated / modified with bis diazobenzidine. 5) lmidazolyl group (for instance via histidine). ln one embodiment this group is activated / modified with bis diazobenzidine. 6) Guanidyl group (for instance via arginine). 7) lndolyl group (for instance via tryptophan).On the serotype 9N saccharide, in general the following groups can be used for a coupling: OH, COOH or NH2. Aldehyde groups can be generated after different treatments known in the art such as: periodate, acid hydrolysis, hydrogen peroxide, etc. ln an embodiment, the serotype 9N glycoconjugate of the present invention is prepared using CDAP chemistry. In said embodiment, the serotype 9N saccharide is activated with 1- cyano-4-dimethylamino pyridinium tetrafluoroborate (CDAP) to form a cyanate ester. The activated saccharide can then be coupled directly or via a spacer (linker) group to an amino group on the carrier protein. For example, the spacer could be cystamine or cysteamine to give a thiolated polysaccharide which can be coupled to the carrier via a thioether linkage obtained after reaction with a maleimide-activated carrier protein (for example using N-[γ- maleimidobutyrloxy]succinimide ester (GMBS)) or a haloacetylated carrier protein (for example using iodoacetimide, N-succinimidyl bromoacetate (SBA; SIB), N-succinimidyl(4- iodoacetyl)aminobenzoate (SlAB), sulfosuccinimidyl(4-iodoacetyl)aminobenzoate (sulfo-SIAB), N-succinimidyl iodoacetate (SIA), or succinimidyl 3-[bromoacetamido]proprionate (SBAP)). In a preferred embodiment, the cyanate ester of the activated saccharide is coupled with hexane diamine or adipic acid dihydrazide (ADH) and the amino-derivatised saccharide is conjugated to the carrier protein using carbodiimide (e.g., EDAC or EDC) chemistry via a carboxyl group on the protein carrier. Such conjugates are described for example in WO 93 / 15760, WO 95 / 08348 and WO 96 / 129094. ln an embodiment, the serotype 9N glycoconjugate of the present invention is prepared using carbodiimides, hydrazides, active esters, norborane, p-nitrobenzoic acid, N- hydroxysuccinimide, S--NHS, EDC, TSTU. Many are described in International Patent Application Publication No. WO 98 / 42721. Conjugation may involve a carbonyl linker which may be formed by reaction of a free hydroxyl group of the saccharide with CDI (see Bethell et al. (1979) 1. Biol. Chern.254:2572-2574; Hearn et al. (1981) J. Chromatogr.218:509-518) followed by reaction with a protein to form a carbamate linkage. This may involve reduction of the anomeric terminus to a primary hydroxyl group, optional protection / deprotection of the primary hydroxyl group, reaction of the primary hydroxyl group with CDI to form a CDI carbamate intermediate and coupling the CDI carbamate intermediate with an amino group on a protein. CDI and / or CDT chemistry In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by CDI and / or CDT chemistry as disclosed in WO2022249107. CDI and / or CDT chemistry involves two steps, (1) reacting the serotype 9N saccharide with CDI and / or CDT in an aprotic solvent to produce an activated saccharide (activation), (2) reacting the activated saccharide with a carrier protein (e.g. CRM197, TT or SCP) to form a glycoconjugate. In an embodiment, the activating agent of step (1) is 1,1’-carbonyldiimidazole (CDI). In an embodiment, the activating agent of step (1) is 1,1'-Carbonyl-di-(1,2,4-triazole) (CDT).As mentioned above, before activation with CDI and / or CDT, sizing of the serotype 9N saccharide to a target molecular weight (MW) range can be performed. Therefore, in an embodiment, the serotype 9N saccharide is sized before activation with CDI. In an embodiment, the isolated polysaccharide is sized before activation with CDT. In an embodiment, the serotype 9N saccharide is sized to any of the target molecular weight (MW) range defined above. Therefore, in an embodiment, the serotype 9N saccharide is conjugated to a carrier protein by a process comprising the step of: (a) reacting said isolated polysaccharide with CDI and / or CDT in an aprotic solvent; (b) reacting the activated polysaccharide of step (a) with a carrier protein in an aprotic solvent to form a glycoconjugate. Following step (a) the polysaccharide is said to be activated and is referred to as “activated polysaccharide”. In one embodiment step a) comprises reacting the serotype 9N saccharide with CDI. In one embodiment step a) comprises reacting the serotype 9N saccharide with an amount of CDI that is between 0.5-10 molar equivalent to the amount of serotype 9N saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the serotype 9N saccharide with CDT. In one embodiment step a) comprises reacting the serotype 9N saccharide with an amount of CDT hat is between 0.5-10 molar equivalent to the amount of serotype 9N saccharide present in the reaction mixture. In an embodiment, the activating reaction a) is carried out in the presence of dimethylsulphoxide (DMSO), dimethylformamide (DMF), dimethylacetamide, N-methyl-2- pyrrolidone or hexamethylphosphoramide (HMPA). In an embodiment, the activating reaction a) is carried out in the presence of dimethylsulphoxide (DMSO). In one embodiment the activating reaction a) is carried out in a solution consisting essentially of dimethylsulphoxide (DMSO) or dimethylformamide (DMF). In one embodiment the activating reaction a) is carried out in a solution consisting essentially of dimethylsulphoxide (DMSO). In an embodiment, the conjugation reaction b) is carried out in the presence of dimethylsulphoxide (DMSO), dimethylformamide (DMF), dimethylacetamide, N-methyl-2- pyrrolidone or hexamethylphosphoramide (HMPA). In an embodiment, the conjugation reaction b) is carried out in the presence of dimethylsulphoxide (DMSO). In one embodiment the conjugation reaction b) is carried out in a solution consisting essentially of dimethylsulphoxide (DMSO) or dimethylformamide (DMF). In one embodiment the conjugation reaction b) is carried out in a solution consisting essentially of dimethylsulphoxide (DMSO).In one embodiment, weak organic base can be added to the reaction mixture after the activating reaction a) but before the conjugation reaction b). The weak organic base can be added before or after the carrier protein is introduced the reaction mixture. Therefore, in one embodiment, the weak organic base is added to the reaction mixture before the carrier protein is introduced. In another embodiment, the weak organic base is added to the reaction mixture after the carrier protein is introduced. Weak organic base can be selected from alkanamines, imidazole, triazole, pyridine, histidine and guanidine. Alkanamines include alkyl primary amines such as methyl amine, ethylamine, propylamine, isopropylamine; alkyl secondary amines such as dimethyl amine, diethylamine, dipropylamine, diisopropylamine; alkyl tertially amines such as trimethyl amine, triethylamine, tri-isopropylamine, di-N,N’-isopropylethylamine, et al. In an embodiment, the weak organic base is an alkanamine. In an embodiment, the weak organic base is an imidazole. In an embodiment, the weak organic base is a triazole. In an embodiment, the weak organic base is pyridine. In an embodiment, the weak organic base is histidine. In an embodiment, the weak organic base is guanidine. In one embodiment following the conjugation reaction b) unconjugated reactive sites of the activated polysaccharide are hydrolyzed. In one embodiment unconjugated reactive sites are hydrolyzed by addition to the conjugation solution of an aqueous solution. In one embodiment unconjugated reactive sites are hydrolyzed by addition to the conjugation solution of an aqueous buffered solution. In one embodiment unconjugated reactive sites are hydrolyzed by addition to the conjugation solution of an aqueous buffered solution and adjustment of the pH to between about 3.0 to about 10.0. In one embodiment unconjugated reactive sites are hydrolyzed by addition to the conjugation solution of an aqueous buffered solution and adjustment of the pH to between about 7.0 to about 10.0. In one embodiment unconjugated reactive sites are hydrolyzed by addition to the conjugation solution of an aqueous buffered solution and adjustment of the pH to between about 3.0 to about 7.0. In one embodiment unconjugated reactive sites are hydrolyzed by addition to the conjugation solution of an aqueous buffered solution and adjustment of the pH to about 4.0. In one embodiment unconjugated reactive sites are hydrolyzed by addition to the conjugation solution of an aqueous buffered solution and adjustment of the pH to about 9.0. Following conjugation to the carrier protein, the serotype 9N glycoconjugate of the invention can be purified (enriched with respect to the amount of saccharide-protein conjugate) by a variety of techniques known to the skilled person. These techniques include dialysis, concentration / diafiltration operations, tangential flow filtration precipitation / elution, column chromatography (DEAE or hydrophobic interaction chromatography), and depth filtration. Therefore, in one embodiment the process for producing the glycoconjugate of the present invention comprises the step of purifying the glycoconjugate after it is produced. eTEC chemistry In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by eTEC chemistry as disclosed WO2014027302The eTEC spacer includes seven linear atoms (i.e., –C(O)NH(CH2)2SCH2C(O)- ) and provides stable thioether and amide bonds between the saccharide and carrier protein. Synthesis of the eTEC linked glycoconjugate involves reaction of an activated hydroxyl group of the saccharide with the amino group of a thioalkylamine reagent, e.g., cystamine or cysteinamine or a salt thereof, forming a carbamate linkage to the saccharide to provide a thiolated saccharide. Generation of one or more free sulfhydryl groups is accomplished by reaction with a reducing agent to provide an activated thiolated saccharide. Reaction of the free sulfhydryl groups of the activated thiolated saccharide with an activated carrier protein having one or more α- haloacetamide groups on amine containing residues generates a thioether bond to form the conjugate, wherein the carrier protein is attached to the eTEC spacer through an amide bond. Therefore, in an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N saccharide covalently conjugated to a carrier protein through a (2-((2- oxoethyl)thio)ethyl)carbamate (eTEC) spacer. In an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N saccharide conjugated to a carrier protein through a (2-((2- oxoethyl)thio)ethyl)carbamate (eTEC) spacer, wherein the saccharide is covalently linked to the eTEC spacer through a carbamate linkage, and wherein the carrier protein is covalently linked to the eTEC spacer through an amide linkage. The eTEC linked glycoconjugates of the invention may be represented by the general formula (III):(III), where (saccharide) represents the serotype 9N saccharide. Formula (III) is a schematic representation of glycoconjugates of the invention. It should not be understood that only one linkage is present between the saccharide and the carrier protein. Rather, an individual carrier protein (CP) molecule may be linked to more than one serotype 9N saccharide molecule and an individual saccharide molecule can be linked to more than one individual carrier protein (CP) molecule. Additionally, a majority of the saccharide repeating unit remains unmodified and covalent linkages between the carrier protein and the saccharide is for a minority of the saccharide repeat units. Direct reductive amination In a preferred embodiment, the serotype 9N glycoconjugate of the present invention is prepared by direct reductive amination (see e.g. US 4365170, US 4673574, WO2006 / 110381, WO2008 / 079653, WO2008 / 143709, WO2008 / 079732, WO2011 / 110531, WO2012 / 119972, WO2015110941, WO2015110940, WO2018 / 144439, WO2018 / 156491).According to the present invention, reductive amination involves two steps, (1) oxidation (activation) of the serotype 9N purified saccharide, (2) reduction of the activated saccharide and the carrier protein (e.g., CRM197or SCP) to form a glycoconjugate. As mentioned above, before oxidation, sizing of the serotype 9N saccharide to a target molecular weight (MW) range can be performed. Therefore, in an embodiment, the isolated polysaccharide is sized before oxidation. In an embodiment, the serotype 9N saccharide of the invention is conjugated to a carrier protein by a process comprising the step of: (a) reacting said serotype 9N saccharide with an oxidizing agent; (b) compounding the activated saccharide of step (a) with a carrier protein; and (c) reacting the compounded activated saccharide and carrier protein with a reducing agent to form a glycoconjugate. Following the oxidation step (a) the saccharide is said to be activated and is referred to as “activated saccharide”. In an embodiment, the serotype 9N saccharide of the invention is conjugated to a carrier protein by a process comprising the step of: (a) reacting said serotype 9N saccharide with an oxidizing agent; (a’) quenching the oxidation reaction by addition of a quenching agent; (b) compounding the activated saccharide of step (a’) with a carrier protein; and (c) reacting the compounded activated saccharide and carrier protein with a reducing agent to form a glycoconjugate. Following the oxidation step (a) the saccharide is said to be activated and is referred to as “activated saccharide”. In an embodiment, the oxidizing agent is any oxidizing agent which oxidizes a terminal hydroxyl group to an aldehyde. In an embodiment, the oxidizing agent is periodate. For the purpose of the present invention, the term “periodate” includes both periodate and periodic acid; the term also includes both metaperiodate (IO4-) and orthoperiodate (IO65-) and the various salts of periodate (e.g., sodium periodate and potassium periodate). In an embodiment, the oxidizing agent is periodate in the presence of bivalent cations (see WO2008 / 143709). In an embodiment, the oxidizing agent is periodic acid. In an embodiment, the oxidizing agent is periodic acid in the presence of bivalent cations. In an embodiment, the oxidizing agent is periodic acid in the presence of Mg2+. In an embodiment, the oxidizing agent is periodic acid in the presence of Ca2+. In an embodiment, the oxidizing agent is orthoperiodate. In a preferred embodiment, the oxidizing agent is sodium periodate. In an embodiment, the periodate used for the oxidation is metaperiodate. In an embodiment the periodate used for the oxidation is sodium metaperiodate.When a polysaccharide reacts with periodate, periodate oxidises vicinal hydroxyl groups to form carbonyl or aldehyde groups and causes cleavage of a C-C bond. For this reason, the term “reacting a polysaccharide with periodate” includes oxidation of vicinal hydroxyl groups by periodate. In one embodiment step a) comprises reacting the polysaccharide with 0.01-2 molar equivalents of periodate. In one embodiment step a) comprises reacting the polysaccharide with 0.1-1.0 molar equivalents of periodate. In one embodiment step a) comprises reacting the polysaccharide with 0.1-0.5 molar equivalents of periodate. In an embodiment, the oxidizing agent is a mixture of a stable nitroxyl radical compound with an oxidant (see WO2014097099). In an aspect, said stable nitroxyl radical compound is a molecule bearing a TEMPO or a PROXYL (2,2,5,5-tetramethyl-1-pyrrolidinyloxy) moiety. Preferably said molecule has the ability to selectively oxidize primary alcohol in the presence of an oxidant, to generate aldehyde groups, without affecting secondary hydroxyl groups. More preferably said molecule has the ability to selectively oxidize primary alcohol in the presence of an oxidant, to generate aldehyde groups, without over oxidation to carboxyl groups. In an aspect, said stable nitroxyl radical compound is TEMPO, 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1-piperidinooxy, 4-Phosphonooxy-TEMPO, 4-Oxo-TEMPO, 4-Methoxy-TEMPO, 4-Isothiocyanato-TEMPO, 4-(2-Iodoacetamido)-TEMPO free radical, 4-Hydroxy-TEMPO, 4-Cyano-TEMPO, 4-Carboxy-TEMPO, 4-(2-Bromoacetamido)- TEMPO or 4-Amino-TEMPO, 4-Acetamido-2,2,6,6-tetramethylpiperidine 1-oxyl. Preferably said stable nitroxyl radical compound is TEMPO. In an aspect, said stable nitroxyl radical compound is selected from the groups consisting of TEMPO, 2,2,6,6-Tetramethyl-4-(methylsulfonyloxy)-1- piperidinooxy, 4-Phosphonooxy-TEMPO, 4-Oxo-TEMPO, 4-Methoxy-TEMPO, 4-Isothiocyanato- TEMPO, 4-(2-Iodoacetamido)-TEMPO free radical, 4-Hydroxy-TEMPO, 4-Cyano-TEMPO, 4- Carboxy-TEMPO, 4-(2-Bromoacetamido)-TEMPO, 4-Amino-TEMPO, 4-Acetamido-2,2,6,6- tetramethylpiperidine 1-oxyl. Preferably said stable nitroxyl radical compound is TEMPO. In a further aspect, said stable nitroxyl radical compound is 3β-DOXYL-5α-cholestane, 5-DOXYL- stearic acid, 16-DOXYL-stearic acid, Methyl 5-DOXYL-stearate, 3-(Aminomethyl)-PROXYL, 3- Carbamoyl-PROXYL, 3-Carbamoyl-2,2,5,5-tetramethyl-3-pyrrolin-1-oxyl, 3-Carboxy-PROXYL or 3-Cyano-PROXYL. In a further aspect, said stable nitroxyl radical compound is selected from the groups consisting of 3β-DOXYL-5α-cholestane, 5-DOXYL-stearic acid, 16-DOXYL-stearic acid, Methyl 5-DOXYL-stearate, 3-(Aminomethyl)-PROXYL, 3-Carbamoyl-PROXYL, 3-Carbamoyl- 2,2,5,5-tetramethyl-3-pyrrolin-1-oxyl, 3-Carboxy-PROXYL, 3-Cyano-PROXYL. In an aspect, the oxidant is a molecule bearing a N-halo moiety. Preferably said molecule has the ability to selectively oxidize primary alcohol in the presence of a nitroxyl radical compound. In an aspect, said oxidant is N-Chlorosuccinimide, N-Bromosuccinimide, N-Iodosuccinimide, Dichloroisocyanuric acid, 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione, Dibromoisocyanuric acid, 1,3,5-tribromo-1,3,5-triazinane-2,4,6-trione, Diiodoisocyanuric acid or 1,3,5-triiodo-1,3,5-triazinane-2,4,6-trione. In an aspect, said oxidant is selected from the group consisting of N- Chlorosuccinimide, N-Bromosuccinimide, N-Iodosuccinimide, Dichloroisocyanuric acid, 1,3,5- trichloro-1,3,5-triazinane-2,4,6-trione, Dibromoisocyanuric acid, 1,3,5-tribromo-1,3,5-triazinane- 2,4,6-trione, Diiodoisocyanuric acid and 1,3,5-triiodo-1,3,5-triazinane-2,4,6-trione. Preferably said oxidant is N-Chlorosuccinimide. In an aspect, said stable nitroxyl radical compound is 2,2,6,6-Tetramethyl-1-piperidinyloxy free radical (TEMPO) and said oxidant is N-Chlorosuccinimide (NCS). In one embodiment, the quenching agent of step a’) is selected from vicinal diols, 1,2- aminoalcohols, amino acids, glutathione, sulfite, bisulfate, dithionite, metabisulfite, thiosulfate, phosphites, hypophosphites or phosphorous acid. In one embodiment, the quenching agent is a 1,2-aminoalcohols of formula (I):wherein R1is selected from H, methyl, ethyl, propyl or isopropyl. In one embodiment, the quenching agent is selected from sodium and potassium salts of sulfite, bisulfate, dithionite, metabisulfite, thiosulfate, phosphites, hypophosphites or phosphorous acid. In one embodiment, the quenching agent is an amino acid. In such embodiments, said amino acid may be selected from serine, threonine, cysteine, cystine, methionine, proline, hydroxyproline, tryptophan, tyrosine, and histidine. In one embodiment, the quenching agent is a sulfite such as bisulfate, dithionite, metabisulfite, thiosulfate. In one embodiment, the quenching agent is a compound comprising two vicinal hydroxyl groups (vicinal diols), i.e., two hydroxyl groups covalently linked to two adjacent carbon atoms. Preferably, the quenching agent is a compound of formula (II):wherein R1and R2are each independently selected from H, methyl, ethyl, propyl or isopropyl. In a preferred embodiment, the quenching agent is glycerol, ethylene glycol, propan-1,2-diol, butan-1,2-diol or butan-2,3-diol, or ascorbic acid. In an even preferred embodiment, the quenching agent is butan-2,3-diol. In a preferred embodiment the degree of oxidation (also named “degree of activation” in the present document) of the activated serotype 9N saccharide is between 2 and 30. In an embodiment the degree of oxidation (DO) of the activated serotype 9N saccharide is between 5In one embodiment the activated saccharide and the carrier protein are lyophilised before step b). In an embodiment the initial input ratio (weight by weight) of activated serotype 9N saccharide to carrier protein at step b) is between 4:1 and 0.1:1. In an embodiment the initial input ratio (weight by weight) of activated serotype 9N saccharide to carrier protein at step b) is between 1.5:1 and 0.5:1. In an embodiment, the reduction reaction (c) is carried out in aqueous solvent. In a preferred embodiment, the reduction reaction (c) is carried out in aprotic solvent. In some such embodiment, the reduction reaction (c) is carried out in the presence of dimethylsulphoxide (DMSO) or dimethylformamide (DMF). Preferably, , the reduction reaction (c) is carried out in aprotic solvent in the presence of dimethylsulphoxide (DMSO). In a preferred embodiment the reduction reaction (c) is carried out in a solution consisting essentially of dimethylsulphoxide (DMSO) or dimethylformamide (DMF). Even more preferably, the reduction reaction (c) is carried out in a solution consisting essentially of dimethylsulphoxide (DMSO). In an embodiment, the reduction reaction (c) is carried out in DMSO (dimethylsulfoxide) solvent. In an embodiment, the reducing agent is sodium cyanoborohydride, sodium triacetoxyborohydride, sodium or zinc borohydride in the presence of Bronsted or Lewis acids, amine boranes such as pyridine borane, 2-Picoline Borane, 2,6-diborane-methanol, dimethylamine-borane, t-BuMeiPrN-BH3, benzylamine-BH3or 5-ethyl-2-methylpyridine borane (PEMB). In an embodiment, the reducing agent is sodium triacetoxyborohydride. In a preferred embodiment, the reducing agent is sodium cyanoborohydride. In an embodiment, the reducing agent is sodium cyanoborohydride in the present of nickel (see WO2018144439). In one embodiment between 0.2 and 20 molar equivalents of reducing agent is used at step c). In one embodiment between 0.5 and 10 molar equivalents of reducing agent is used at step c). In a preferred embodiment between 0.5 and 2.5 molar equivalents of reducing agent is used at step c). At the end of the reduction reaction, there may be unreacted aldehyde groups remaining in the conjugates, these may be capped using a suitable capping agent. In one embodiment this capping agent is sodium borohydride (NaBH4). In an embodiment capping is achieved by mixing the product of step c) with 1 to 20 molar equivalents of sodium borohydride. In an embodiment capping is achieved by mixing the product of step c) with 1 to 10 molar equivalents of sodium borohydride. In an embodiment capping is achieved by mixing the product of step c) with 1 to 5 molar equivalents of sodium borohydride. Following conjugation to the carrier protein, the serotype 9N glycoconjugate of the invention can be purified (enriched with respect to the amount of saccharide-protein conjugate) by a variety of techniques known to the skilled person. These techniques include dialysis,concentration / diafiltration operations, tangential flow filtration precipitation / elution, column chromatography (DEAE or hydrophobic interaction chromatography), and depth filtration. Therefore, in one embodiment the process for producing the glycoconjugate of the present invention comprises the step of purifying the glycoconjugate after it is produced. Click chemistry In a very preferred embodiment of the present invention, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry (see e.g. WO2023 / 135515). Therefore, in an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV):(IV), wherein X is selected from the group consisting of CH2(CH2)n’, (CH2CH2O)mCH2CH2, NHCO(CH2)n’, NHCO(CH2CH2O)mCH2CH2, OCH2(CH2)n’and O(CH2CH2O)mCH2CH2; where n’ is selected from 1 to 10 and m is selected from 1 to 4, wherein X' is selected from the group consisting of CH2O(CH2)n’’CH2C=O, CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4, wherein the structure in square backet represents a repeat unit of the serotype 9N saccharide and wherein n represents the number of repeating units. In a preferred embodiement, the invention is directed to a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is CH2(CH2)n’, where n’ is 2 and wherein X' is CH2O(CH2)n’’CH2C=O where n’’ is 1. Therefore, in a preferred embodiment, the invention pertains to a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (V),wherein the structure in square backet represents a repeat unit of the serotype 9N saccharide and wherein n represents the number of repeating units. Formulas (IV) and (V) are schematic representations of the preferred glycoconjugates of the invention. It should not be understood that a linkage is present at every repeating unit of the saccharide (the structure in square brackets). Rather, a majority of the saccharide repeating unit remains unmodified and covalent linkages between the carrier protein and the saccharide is for a minority of the saccharide repeat units. Additionally, an individual carrier protein (CP) molecule may be linked to more than one saccharide molecule and an individual saccharide molecule can be linked to more than one individual carrier protein (CP) molecule. The structure in square brackets represents a repeat unit of the serotype 9N saccharide. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is CH2(CH2)n’, where n’ is selected from 1 to 10 and werein X' is CH2O(CH2)n’’CH2C=O where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6.In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is CH2(CH2)n’, where n’ is selected from 1 to 10 and werein CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 0. In another embodiment, n’ is 1, m’ is 1 and n’’ is 0. In another embodiment, n’ is 1, m’ is 2 and n’’ is 0. In another embodiment, n’ is 1, m’ is 3 and n’’ is 0. In another embodiment, n’ is 2, m’ is 0 and n’’ is 0. In another embodiment, n’ is 2, m’ is 1 and n’’ is 0. In another embodiment, n’ is 2, m’ is 2 and n’’ is 0. In another embodiment, n’ is 2, m’ is 3 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 0.In yet a further embodiment, n’ is 5, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 0. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 1. In another embodiment, n’ is 2, m’ is 0 and n’’ is 1. In another embodiment, n’ is 2, m’ is 1 and n’’ is 1. In another embodiment, n’ is 2, m’ is 2 and n’’ is 1. In another embodiment, n’ is 2, m’ is 3 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 1.In yet a further embodiment, n’ is 5, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 2. In another embodiment, n’ is 2, m’ is 0 and n’’ is 2. In another embodiment, n’ is 2, m’ is 1 and n’’ is 2. In another embodiment, n’ is 2, m’ is 2 and n’’ is 2. In another embodiment, n’ is 2, m’ is 3 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 2. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 3. In another embodiment, n’ is 2, m’ is 0 and n’’ is 3. In another embodiment, n’ is 2, m’ is 1 and n’’ is 3. In another embodiment, n’ is 2, m’ is 2 and n’’ is 3. In another embodiment, n’ is 2, m’ is 3 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 3. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 4.In another embodiment, n’ is 2, m’ is 0 and n’’ is 4. In another embodiment, n’ is 2, m’ is 1 and n’’ is 4. In another embodiment, n’ is 2, m’ is 2 and n’’ is 4. In another embodiment, n’ is 2, m’ is 3 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 4. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 5. In another embodiment, n’ is 2, m’ is 0 and n’’ is 5. In another embodiment, n’ is 2, m’ is 1 and n’’ is 5. In another embodiment, n’ is 2, m’ is 2 and n’’ is 5. In another embodiment, n’ is 2, m’ is 3 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is (CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and werein X' is CH2O(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In aparticular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In a particular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is (CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and werein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, m is selected from 1 to 3, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 0. In another embodiment, m is 1, m’ is 1 and n’’ is 0. In another embodiment, m is 1, m’ is 2 and n’’ is 0. In another embodiment, m is 1, m’ is 3 and n’’ is 0. In another embodiment, m is 2, m’ is 0 and n’’ is 0. In another embodiment, m is 2, m’ is 1 and n’’ is 0. In another embodiment, m is 2, m’ is 2 and n’’ is 0. In another embodiment, m is 2, m’ is 3 and n’’ is 0. In yet another embodiment, m is 3, m’ is 0 and n’’ is 0. In yet another embodiment, m is 3, m’ is 1 and n’’ is 0. In yet another embodiment, m is 3, m’ is 2 and n’’ is 0. In yet another embodiment, m is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, m is 4, m’ is 0 and n” is 0. In yet a further embodiment, m is 4, m’ is 1 and n” is 0. In yet a further embodiment, m is 4, m’ is 2 and n” is 0. In yet a further embodiment, m is 4, m’ is 3 and n” is 0. In a particular embodiment, m is 1, m’ is 0 and n’’ is 1. In a particular embodiment, m is 1, m’ is 1 and n’’ is 1. In a particular embodiment, m is 1, m’ is 2 and n’’ is 1. In a particular embodiment, m is 1, m’ is 3 and n’’ is 1. In another embodiment, m is 2, m’ is 0 and n’’ is 1. In another embodiment, m is 2, m’ is 1 and n’’ is 1. In another embodiment, m is 2, m’ is 2 and n’’ is 1. In another embodiment, m is 2, m’ is 3 and n’’ is 1.In yet another embodiment, m is 3, m’ is 0 and n’’ is 1. In yet another embodiment, m is 3, m’ is 1 and n’’ is 1. In yet another embodiment, m is 3, m’ is 2 and n’’ is 1. In yet another embodiment, m is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, m is 4, m’ is 0 and n” is 1. In yet a further embodiment, m is 4, m’ is 1 and n” is 1. In yet a further embodiment, m is 4, m’ is 2 and n” is 1. In yet a further embodiment, m is 4, m’ is 3 and n” is 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 2. In a particular embodiment, m is 1, m’ is 1 and n’’ is 2. In a particular embodiment, m is 1, m’ is 2 and n’’ is 2. In a particular embodiment, m is 1, m’ is 3 and n’’ is 2. In another embodiment, m is 2, m’ is 0 and n’’ is 2. In another embodiment, m is 2, m’ is 1 and n’’ is 2. In another embodiment, m is 2, m’ is 2 and n’’ is 2. In another embodiment, m is 2, m’ is 3 and n’’ is 2. In yet another embodiment, m is 3, m’ is 0 and n’’ is 2. In yet another embodiment, m is 3, m’ is 1 and n’’ is 2. In yet another embodiment, m is 3, m’ is 2 and n’’ is 2. In yet another embodiment, m is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, m is 4, m’ is 0 and n” is 2. In yet a further embodiment, m is 4, m’ is 1 and n” is 2. In yet a further embodiment, m is 4, m’ is 2 and n” is 2. In yet a further embodiment, m is 4, m’ is 3 and n” is 2. In a particular embodiment, m is 1, m’ is 0 and n’’ is 3. In a particular embodiment, m is 1, m’ is 1 and n’’ is 3. In a particular embodiment, m is 1, m’ is 2 and n’’ is 3. In a particular embodiment, m is 1, m’ is 3 and n’’ is 3. In another embodiment, m is 2, m’ is 0 and n’’ is 3. In another embodiment, m is 2, m’ is 1 and n’’ is 3. In another embodiment, m is 2, m’ is 2 and n’’ is 3. In another embodiment, m is 2, m’ is 3 and n’’ is 3. In yet another embodiment, m is 3, m’ is 0 and n’’ is 3. In yet another embodiment, m is 3, m’ is 1 and n’’ is 3. In yet another embodiment, m is 3, m’ is 2 and n’’ is 3. In yet another embodiment, m is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, m is 4, m’ is 0 and n” is 3. In yet a further embodiment, m is 4, m’ is 1 and n” is 3. In yet a further embodiment, m is 4, m’ is 2 and n” is 3. In yet a further embodiment, m is 4, m’ is 3 and n” is 3. In a particular embodiment, m is 1, m’ is 0 and n’’ is 4. In a particular embodiment, m is 1, m’ is 1 and n’’ is 4. In a particular embodiment, m is 1, m’ is 2 and n’’ is 4. In a particular embodiment, m is 1, m’ is 3 and n’’ is 4. In another embodiment, m is 2, m’ is 0 and n’’ is 4. In another embodiment, m is 2, m’ is 1 and n’’ is 4. In another embodiment, m is 2, m’ is 2 and n’’ is 4. In another embodiment, m is 2, m’ is 3 and n’’ is 4.In yet another embodiment, m is 3, m’ is 0 and n’’ is 4. In yet another embodiment, m is 3, m’ is 1 and n’’ is 4. In yet another embodiment, m is 3, m’ is 2 and n’’ is 4. In yet another embodiment, m is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, m is 4, m’ is 0 and n” is 4. In yet a further embodiment, m is 4, m’ is 1 and n” is 4. In yet a further embodiment, m is 4, m’ is 2 and n” is 4. In yet a further embodiment, m is 4, m’ is 3 and n” is 4. In a particular embodiment, m is 1, m’ is 0 and n’’ is 5. In a particular embodiment, m is 1, m’ is 1 and n’’ is 5. In a particular embodiment, m is 1, m’ is 2 and n’’ is 5. In a particular embodiment, m is 1, m’ is 3 and n’’ is 5. In another embodiment, m is 2, m’ is 0 and n’’ is 5. In another embodiment, m is 2, m’ is 1 and n’’ is 5. In another embodiment, m is 2, m’ is 2 and n’’ is 5. In another embodiment, m is 2, m’ is 3 and n’’ is 5. In yet another embodiment, m is 3, m’ is 0 and n’’ is 5. In yet another embodiment, m is 3, m’ is 1 and n’’ is 5. In yet another embodiment, m is 3, m’ is 2 and n’’ is 5. In yet another embodiment, m is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, m is 4, m’ is 0 and n” is 5. In yet a further embodiment, m is 4, m’ is 1 and n” is 5. In yet a further embodiment, m is 4, m’ is 2 and n” is 5. In yet a further embodiment, m is 4, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is NHCO(CH2)n’, where n’ is selected from 1 to 10 and werein X' is CH2O(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yetanother embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is NHCO(CH2)n’, where n’ is selected from 1 to 10 and werein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 0. In another embodiment, n’ is 1, m’ is 1 and n’’ is 0. In another embodiment, n’ is 1, m’ is 2 and n’’ is 0. In another embodiment, n’ is 1, m’ is 3 and n’’ is 0. In another embodiment, n’ is 2, m’ is 0 and n’’ is 0. In another embodiment, n’ is 2, m’ is 1 and n’’ is 0. In another embodiment, n’ is 2, m’ is 2 and n’’ is 0. In another embodiment, n’ is 2, m’ is 3 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 0.In yet a further embodiment, n’ is 5, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 0. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 1.In another embodiment, n’ is 2, m’ is 0 and n’’ is 1. In another embodiment, n’ is 2, m’ is 1 and n’’ is 1. In another embodiment, n’ is 2, m’ is 2 and n’’ is 1. In another embodiment, n’ is 2, m’ is 3 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 2. In another embodiment, n’ is 2, m’ is 0 and n’’ is 2. In another embodiment, n’ is 2, m’ is 1 and n’’ is 2. In another embodiment, n’ is 2, m’ is 2 and n’’ is 2. In another embodiment, n’ is 2, m’ is 3 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 2. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 3. In another embodiment, n’ is 2, m’ is 0 and n’’ is 3. In another embodiment, n’ is 2, m’ is 1 and n’’ is 3. In another embodiment, n’ is 2, m’ is 2 and n’’ is 3. In another embodiment, n’ is 2, m’ is 3 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 3.In yet a further embodiment, n’ is 4, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 3. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 4. In another embodiment, n’ is 2, m’ is 0 and n’’ is 4. In another embodiment, n’ is 2, m’ is 1 and n’’ is 4. In another embodiment, n’ is 2, m’ is 2 and n’’ is 4. In another embodiment, n’ is 2, m’ is 3 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 4. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 5. In another embodiment, n’ is 2, m’ is 0 and n’’ is 5. In another embodiment, n’ is 2, m’ is 1 and n’’ is 5. In another embodiment, n’ is 2, m’ is 2 and n’’ is 5. In another embodiment, n’ is 2, m’ is 3 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer andhaving the general formula (IV), wherein X is NHCO(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and werein X' is CH2O(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In a particular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is NHCO(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and werein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, m is selected from 1 to 3, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 0. In another embodiment, m is 1, m’ is 1 and n’’ is 0. In another embodiment, m is 1, m’ is 2 and n’’ is 0. In another embodiment, m is 1, m’ is 3 and n’’ is 0. In another embodiment, m is 2, m’ is 0 and n’’ is 0. In another embodiment, m is 2, m’ is 1 and n’’ is 0. In another embodiment, m is 2, m’ is 2 and n’’ is 0. In another embodiment, m is 2, m’ is 3 and n’’ is 0. In yet another embodiment, m is 3, m’ is 0 and n’’ is 0. In yet another embodiment, m is 3, m’ is 1 and n’’ is 0. In yet another embodiment, m is 3, m’ is 2 and n’’ is 0. In yet another embodiment, m is 3, m’ is 3 and n’’ is 0.In yet a further embodiment, m is 4, m’ is 0 and n” is 0. In yet a further embodiment, m is 4, m’ is 1 and n” is 0. In yet a further embodiment, m is 4, m’ is 2 and n” is 0. In yet a further embodiment, m is 4, m’ is 3 and n” is 0. In a particular embodiment, m is 1, m’ is 0 and n’’ is 1. In a particular embodiment, m is 1, m’ is 1 and n’’ is 1. In a particular embodiment, m is 1, m’ is 2 and n’’ is 1. In a particular embodiment, m is 1, m’ is 3 and n’’ is 1. In another embodiment, m is 2, m’ is 0 and n’’ is 1. In another embodiment, m is 2, m’ is 1 and n’’ is 1. In another embodiment, m is 2, m’ is 2 and n’’ is 1. In another embodiment, m is 2, m’ is 3 and n’’ is 1. In yet another embodiment, m is 3, m’ is 0 and n’’ is 1. In yet another embodiment, m is 3, m’ is 1 and n’’ is 1. In yet another embodiment, m is 3, m’ is 2 and n’’ is 1. In yet another embodiment, m is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, m is 4, m’ is 0 and n” is 1. In yet a further embodiment, m is 4, m’ is 1 and n” is 1. In yet a further embodiment, m is 4, m’ is 2 and n” is 1. In yet a further embodiment, m is 4, m’ is 3 and n” is 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 2. In a particular embodiment, m is 1, m’ is 1 and n’’ is 2. In a particular embodiment, m is 1, m’ is 2 and n’’ is 2. In a particular embodiment, m is 1, m’ is 3 and n’’ is 2. In another embodiment, m is 2, m’ is 0 and n’’ is 2. In another embodiment, m is 2, m’ is 1 and n’’ is 2. In another embodiment, m is 2, m’ is 2 and n’’ is 2. In another embodiment, m is 2, m’ is 3 and n’’ is 2. In yet another embodiment, m is 3, m’ is 0 and n’’ is 2. In yet another embodiment, m is 3, m’ is 1 and n’’ is 2. In yet another embodiment, m is 3, m’ is 2 and n’’ is 2. In yet another embodiment, m is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, m is 4, m’ is 0 and n” is 2. In yet a further embodiment, m is 4, m’ is 1 and n” is 2. In yet a further embodiment, m is 4, m’ is 2 and n” is 2. In yet a further embodiment, m is 4, m’ is 3 and n” is 2. In a particular embodiment, m is 1, m’ is 0 and n’’ is 3. In a particular embodiment, m is 1, m’ is 1 and n’’ is 3. In a particular embodiment, m is 1, m’ is 2 and n’’ is 3. In a particular embodiment, m is 1, m’ is 3 and n’’ is 3. In another embodiment, m is 2, m’ is 0 and n’’ is 3. In another embodiment, m is 2, m’ is 1 and n’’ is 3. In another embodiment, m is 2, m’ is 2 and n’’ is 3. In another embodiment, m is 2, m’ is 3 and n’’ is 3. In yet another embodiment, m is 3, m’ is 0 and n’’ is 3. In yet another embodiment, m is 3, m’ is 1 and n’’ is 3. In yet another embodiment, m is 3, m’ is 2 and n’’ is 3. In yet another embodiment, m is 3, m’ is 3 and n’’ is 3.In yet a further embodiment, m is 4, m’ is 0 and n” is 3. In yet a further embodiment, m is 4, m’ is 1 and n” is 3. In yet a further embodiment, m is 4, m’ is 2 and n” is 3. In yet a further embodiment, m is 4, m’ is 3 and n” is 3. In a particular embodiment, m is 1, m’ is 0 and n’’ is 4. In a particular embodiment, m is 1, m’ is 1 and n’’ is 4. In a particular embodiment, m is 1, m’ is 2 and n’’ is 4. In a particular embodiment, m is 1, m’ is 3 and n’’ is 4. In another embodiment, m is 2, m’ is 0 and n’’ is 4. In another embodiment, m is 2, m’ is 1 and n’’ is 4. In another embodiment, m is 2, m’ is 2 and n’’ is 4. In another embodiment, m is 2, m’ is 3 and n’’ is 4. In yet another embodiment, m is 3, m’ is 0 and n’’ is 4. In yet another embodiment, m is 3, m’ is 1 and n’’ is 4. In yet another embodiment, m is 3, m’ is 2 and n’’ is 4. In yet another embodiment, m is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, m is 4, m’ is 0 and n” is 4. In yet a further embodiment, m is 4, m’ is 1 and n” is 4. In yet a further embodiment, m is 4, m’ is 2 and n” is 4. In yet a further embodiment, m is 4, m’ is 3 and n” is 4. In a particular embodiment, m is 1, m’ is 0 and n’’ is 5. In a particular embodiment, m is 1, m’ is 1 and n’’ is 5. In a particular embodiment, m is 1, m’ is 2 and n’’ is 5. In a particular embodiment, m is 1, m’ is 3 and n’’ is 5. In another embodiment, m is 2, m’ is 0 and n’’ is 5. In another embodiment, m is 2, m’ is 1 and n’’ is 5. In another embodiment, m is 2, m’ is 2 and n’’ is 5. In another embodiment, m is 2, m’ is 3 and n’’ is 5. In yet another embodiment, m is 3, m’ is 0 and n’’ is 5. In yet another embodiment, m is 3, m’ is 1 and n’’ is 5. In yet another embodiment, m is 3, m’ is 2 and n’’ is 5. In yet another embodiment, m is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, m is 4, m’ is 0 and n” is 5. In yet a further embodiment, m is 4, m’ is 1 and n” is 5. In yet a further embodiment, m is 4, m’ is 2 and n” is 5. In yet a further embodiment, m is 4, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is OCH2(CH2)n’, where n’ is selected from 1 to 10 and werein X' is CH2O(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yetanother embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is OCH2(CH2)n’, where n’ is selected from 1 to 10 and werein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 0. In another embodiment, n’ is 1, m’ is 1 and n’’ is 0. In another embodiment, n’ is 1, m’ is 2 and n’’ is 0. In another embodiment, n’ is 1, m’ is 3 and n’’ is 0. In another embodiment, n’ is 2, m’ is 0 and n’’ is 0. In another embodiment, n’ is 2, m’ is 1 and n’’ is 0. In another embodiment, n’ is 2, m’ is 2 and n’’ is 0. In another embodiment, n’ is 2, m’ is 3 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 0.In yet a further embodiment, n’ is 4, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 0.In yet a further embodiment, n’ is 5, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 0. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 1. In another embodiment, n’ is 2, m’ is 0 and n’’ is 1. In another embodiment, n’ is 2, m’ is 1 and n’’ is 1. In another embodiment, n’ is 2, m’ is 2 and n’’ is 1. In another embodiment, n’ is 2, m’ is 3 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 2. In another embodiment, n’ is 2, m’ is 0 and n’’ is 2. In another embodiment, n’ is 2, m’ is 1 and n’’ is 2. In another embodiment, n’ is 2, m’ is 2 and n’’ is 2. In another embodiment, n’ is 2, m’ is 3 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 2.In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 3. In another embodiment, n’ is 2, m’ is 0 and n’’ is 3. In another embodiment, n’ is 2, m’ is 1 and n’’ is 3. In another embodiment, n’ is 2, m’ is 2 and n’’ is 3. In another embodiment, n’ is 2, m’ is 3 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 3. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 4. In another embodiment, n’ is 2, m’ is 0 and n’’ is 4. In another embodiment, n’ is 2, m’ is 1 and n’’ is 4. In another embodiment, n’ is 2, m’ is 2 and n’’ is 4. In another embodiment, n’ is 2, m’ is 3 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 4. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 5. In another embodiment, n’ is 2, m’ is 0 and n’’ is 5. In another embodiment, n’ is 2, m’ is 1 and n’’ is 5. In another embodiment, n’ is 2, m’ is 2 and n’’ is 5. In another embodiment, n’ is 2, m’ is 3 and n’’ is 5.In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is O(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In a particular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV), wherein X is O(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, m is selected from 1 to 3, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ isselected from 0 to 3. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 0. In another embodiment, m is 1, m’ is 1 and n’’ is 0. In another embodiment, m is 1, m’ is 2 and n’’ is 0. In another embodiment, m is 1, m’ is 3 and n’’ is 0. In another embodiment, m is 2, m’ is 0 and n’’ is 0. In another embodiment, m is 2, m’ is 1 and n’’ is 0. In another embodiment, m is 2, m’ is 2 and n’’ is 0. In another embodiment, m is 2, m’ is 3 and n’’ is 0. In yet another embodiment, m is 3, m’ is 0 and n’’ is 0. In yet another embodiment, m is 3, m’ is 1 and n’’ is 0. In yet another embodiment, m is 3, m’ is 2 and n’’ is 0. In yet another embodiment, m is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, m is 4, m’ is 0 and n” is 0. In yet a further embodiment, m is 4, m’ is 1 and n” is 0. In yet a further embodiment, m is 4, m’ is 2 and n” is 0. In yet a further embodiment, m is 4, m’ is 3 and n” is 0. In a particular embodiment, m is 1, m’ is 0 and n’’ is 1. In a particular embodiment, m is 1, m’ is 1 and n’’ is 1. In a particular embodiment, m is 1, m’ is 2 and n’’ is 1. In a particular embodiment, m is 1, m’ is 3 and n’’ is 1. In another embodiment, m is 2, m’ is 0 and n’’ is 1. In another embodiment, m is 2, m’ is 1 and n’’ is 1. In another embodiment, m is 2, m’ is 2 and n’’ is 1. In another embodiment, m is 2, m’ is 3 and n’’ is 1. In yet another embodiment, m is 3, m’ is 0 and n’’ is 1. In yet another embodiment, m is 3, m’ is 1 and n’’ is 1. In yet another embodiment, m is 3, m’ is 2 and n’’ is 1. In yet another embodiment, m is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, m is 4, m’ is 0 and n” is 1. In yet a further embodiment, m is 4, m’ is 1 and n” is 1. In yet a further embodiment, m is 4, m’ is 2 and n” is 1. In yet a further embodiment, m is 4, m’ is 3 and n” is 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 2. In a particular embodiment, m is 1, m’ is 1 and n’’ is 2. In a particular embodiment, m is 1, m’ is 2 and n’’ is 2. In a particular embodiment, m is 1, m’ is 3 and n’’ is 2. In another embodiment, m is 2, m’ is 0 and n’’ is 2. In another embodiment, m is 2, m’ is 1 and n’’ is 2. In another embodiment, m is 2, m’ is 2 and n’’ is 2. In another embodiment, m is 2, m’ is 3 and n’’ is 2. In yet another embodiment, m is 3, m’ is 0 and n’’ is 2. In yet another embodiment, m is 3, m’ is 1 and n’’ is 2. In yet another embodiment, m is 3, m’ is 2 and n’’ is 2. In yet another embodiment, m is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, m is 4, m’ is 0 and n” is 2. In yet a further embodiment, m is 4, m’ is 1 and n” is 2. In yet a further embodiment, m is 4, m’ is 2 and n” is 2. In yet a further embodiment, m is 4, m’ is 3 and n” is 2.In a particular embodiment, m is 1, m’ is 0 and n’’ is 3. In a particular embodiment, m is 1, m’ is 1 and n’’ is 3. In a particular embodiment, m is 1, m’ is 2 and n’’ is 3. In a particular embodiment, m is 1, m’ is 3 and n’’ is 3. In another embodiment, m is 2, m’ is 0 and n’’ is 3. In another embodiment, m is 2, m’ is 1 and n’’ is 3. In another embodiment, m is 2, m’ is 2 and n’’ is 3. In another embodiment, m is 2, m’ is 3 and n’’ is 3. In yet another embodiment, m is 3, m’ is 0 and n’’ is 3. In yet another embodiment, m is 3, m’ is 1 and n’’ is 3. In yet another embodiment, m is 3, m’ is 2 and n’’ is 3. In yet another embodiment, m is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, m is 4, m’ is 0 and n” is 3. In yet a further embodiment, m is 4, m’ is 1 and n” is 3. In yet a further embodiment, m is 4, m’ is 2 and n” is 3. In yet a further embodiment, m is 4, m’ is 3 and n” is 3. In a particular embodiment, m is 1, m’ is 0 and n’’ is 4. In a particular embodiment, m is 1, m’ is 1 and n’’ is 4. In a particular embodiment, m is 1, m’ is 2 and n’’ is 4. In a particular embodiment, m is 1, m’ is 3 and n’’ is 4. In another embodiment, m is 2, m’ is 0 and n’’ is 4. In another embodiment, m is 2, m’ is 1 and n’’ is 4. In another embodiment, m is 2, m’ is 2 and n’’ is 4. In another embodiment, m is 2, m’ is 3 and n’’ is 4. In yet another embodiment, m is 3, m’ is 0 and n’’ is 4. In yet another embodiment, m is 3, m’ is 1 and n’’ is 4. In yet another embodiment, m is 3, m’ is 2 and n’’ is 4. In yet another embodiment, m is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, m is 4, m’ is 0 and n” is 4. In yet a further embodiment, m is 4, m’ is 1 and n” is 4. In yet a further embodiment, m is 4, m’ is 2 and n” is 4. In yet a further embodiment, m is 4, m’ is 3 and n” is 4. In a particular embodiment, m is 1, m’ is 0 and n’’ is 5. In a particular embodiment, m is 1, m’ is 1 and n’’ is 5. In a particular embodiment, m is 1, m’ is 2 and n’’ is 5. In a particular embodiment, m is 1, m’ is 3 and n’’ is 5. In another embodiment, m is 2, m’ is 0 and n’’ is 5. In another embodiment, m is 2, m’ is 1 and n’’ is 5. In another embodiment, m is 2, m’ is 2 and n’’ is 5. In another embodiment, m is 2, m’ is 3 and n’’ is 5. In yet another embodiment, m is 3, m’ is 0 and n’’ is 5. In yet another embodiment, m is 3, m’ is 1 and n’’ is 5. In yet another embodiment, m is 3, m’ is 2 and n’’ is 5. In yet another embodiment, m is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, m is 4, m’ is 0 and n” is 5. In yet a further embodiment, m is 4, m’ is 1 and n” is 5. In yet a further embodiment, m is 4, m’ is 2 and n” is 5. In yet a further embodiment, m is 4, m’ is 3 and n” is 5.In a very preferred embodiment of the present invention, the serotype 9N glycoconjugate of the present invention are prepared using click chemistry. The invention also relates to a method of making serotype 9N glycoconjugate, as disclosed herein above. In an embodiment, click chemistry may comprise three steps, (a) reacting an isolated serotype 9N saccharide with a carbonic acid derivative and an azido linker in an aprotic solvent to produce an activated azido saccharide (activation of the saccharide), (b) reacting a carrier protein with an agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group where the NHS moiety reacts with the amino groups to form an amide linkage thereby obtaining an alkyne functionalized carrier protein (activation of the carrier protein), (c) reacting the activated azido saccharide of step (a) with the activated alkyne-carrier protein of step (b) by Cu+1mediated azide-alkyne cycloaddition reaction to form a glycoconjugate. Following step (a) the saccharide is said to be activated and is referred to herein as “activated saccharide” or “activated azido saccharide”. Following step (b) the carrier is said to be activated and is referred to as “activated carrier”. As mentioned above, before the activation (a), sizing of the saccharide to a target molecular weight (MW) range may be performed. Therefore, in an embodiment, the isolated serotype 9N saccharide is sized before activation with a carbonic acid derivative and an azido linker. In an embodiment, the isolated serotype 9N saccharide is sized to any of the target molecular weight (MW) range defined above. In an embodiment, the isolated serotype 9N saccharide is not sized before activation with a carbonic acid derivative and an azido linker. In an embodiment, said carbonic acid derivative is selected from the group consisting of 1,1’-carbonyldiimidazole (CDI), 1,1’-carbonyl-di-(1,2,4-triazole) (CDT), N,N′-Disuccinimidyl carbonate (DSC) and N-hydroxysuccinimidyl chloroformate. In an embodiment, said carbonic acid derivative is 1,1’-carbonyldiimidazole (CDI). In another embodiment, said carbonic acid derivative is 1,1'-Carbonyl-di-(1,2,4-triazole) (CDT). In another embodiment, said carbonic acid derivative is N,N′-Disuccinimidyl carbonate (DSC). In yet a further embodiment, said carbonic acid derivative is N-hydroxysuccinimidyl chloroformate. In an embodiment, said carbonic acid derivative is 1,1’-carbonyldiimidazole (CDI) or 1,1'- Carbonyl-di-(1,2,4-triazole) (CDT). In an embodiment, said carbonic acid derivative is 1,1’- carbonyldiimidazole (CDI). Preferably, said carbonic acid derivative N,N′-Disuccinimidyl carbonate (DSC). In an embodiment, said azido linker is a compound of formula (VI), (VI) wherein X is selected from the group consisting of CH2(CH2)n, (CH2CH2O)mCH2CH2, NHCO(CH2)n, NHCO(CH2CH2O)mCH2CH2, OCH2(CH2)nand O(CH2CH2O)mCH2CH2; where n is selected from 1 to 10 and m is selected from 1 to 4.In an embodiment, said azido linker is a compound of formula (VI), wherein X is CH2(CH2)n, and n is selected from 1 to 10. In an embodiment, n is selected from 1 to 5. In an embodiment, n is selected from 1 to 4. In an embodiment, n is selected from 1 to 3. In an embodiment, n is selected from 1 to 2. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said azido linker is a compound of formula (VI), wherein X is (CH2CH2O)mCH2CH2, wherein m is selected from 1 to 4. In an embodiment, m is selected from 1 to 3. In an embodiment, m is selected from 1 to 2. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4. In an embodiment, said azido linker is a compound of formula (VI), wherein X is NHCO(CH2)n, and n is selected from 1 to 10. In an embodiment, n is selected from 1 to 5. In an embodiment, n is selected from 1 to 4. In an embodiment, n is selected from 1 to 3. In an embodiment, n is selected from 1 to 2. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said azido linker is a compound of formula (VI), wherein X is NHCO(CH2CH2O)mCH2CH2, where m is selected from 1 to 4. In an embodiment, m is selected from 1 to 3. In an embodiment, m is selected from 1 to 2. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4. In an embodiment, said azido linker is a compound of formula (VI), wherein X is OCH2(CH2)n, and n is selected from 1 to 10. In an embodiment, n is selected from 1 to 5. In an embodiment, n is selected from 1 to 4. In an embodiment, n is selected from 1 to 3. In an embodiment, n is selected from 1 to 2. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said azido linker is a compound of formula (VI), wherein X is O(CH2CH2O)mCH2CH2, where m is selected from 1 to 4. In an embodiment, m is selected from 1 to 3. In an embodiment, m is selected from 1 to 2. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4. In an embodiment, said azido linker is a compound of formula (VII),(VII) In a preferred embodiment, said azido linker is 3-azido-propylamine. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group is an agent bearing an N-Hydroxysuccinimide (NHS) moiety and a terminal alkyne. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group is an agent bearing an N-Hydroxysuccinimide (NHS) moiety and a cycloalkyne. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group is a compound of formula (VIII),where X is selected from the group consisting of CH2O(CH2)nCH2C=O and CH2O(CH2CH2O)m(CH2)nCH2C=O, where n is selected from 0 to 10 and m is selected from 0 to 4. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group is a compound of formula (VIII), wherein X is CH2O(CH2)nCH2C=O, where n is selected from 0 to 10. In an embodiment, n is selected from 0 to 5. In an embodiment, n is selected from 0 to 4. In an embodiment, n is selected from 0 to 3. In an embodiment, n is selected from 0 to 2. In a particular embodiment, n is 0. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group is a compound of formula (VIII), wherein X is CH2O(CH2CH2O)m(CH2)nCH2C=O, where n is selected from 0 to 10 and m is selected from 0 to 4. In an embodiment, n is selected from 0 to 5. In an embodiment, n is selected from 0 to 4. In an embodiment, n is selected from 0 to 3. In an embodiment, n is selected from 0 to 2. In a particular embodiment, n is 0. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, m is selected from 0 to 3. In an embodiment, m is selected from 0 to 2. In a particular embodiment, m is 1. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4.In an embodiment, n is selected from 0 to 5 and m is selected from 0 to 3. In an embodiment, n is selected from 0 to 5 and m is selected from 0 to 2. In an embodiment, n is selected from 0 to 4 and m is selected from 0 to 3. In an embodiment, n is selected from 0 to 4 and m is selected from 0 to 2. In an embodiment, n is selected from 0 to 3 and m is selected from 0 to 3. In an embodiment, n is selected from 0 to 3 and m is selected from 0 to 2. In an embodiment, n is selected from 0 to 2 and m is selected from 0 to 3. In an embodiment, n is selected from 0 to 2 and m is selected from 0 to 2. In an embodiment, n is selected from 0 to 1 and m is selected from 0 to 3. In an embodiment, n is selected from 0 to 1 and m is selected from 0 to 2. In an embodiment, n is 0 and m is 0. In an embodiment, n is 1 and m is 0. In an embodiment, n is 2 and m is 0. In an embodiment, n is 3 and m is 0. In an embodiment, n is 4 and m is 0. In an embodiment, n is 5 and m is 0. In an embodiment, n is 6 and m is 0. In an embodiment, n is 7 and m is 0. In an embodiment, n is 8 and m is 0. In an embodiment, n is 9 and m is 0. In an embodiment, n is 10 and m is 0. In an embodiment, n is 0 and m is 1. In an embodiment, n is 1 and m is 1. In an embodiment, n is 2 and m is 1. In an embodiment, n is 3 and m is 1. In an embodiment, n is 4 and m is 1. In an embodiment, n is 5 and m is 1. In an embodiment, n is 6 and m is 1. In an embodiment, n is 7 and m is 1. In an embodiment, n is 8 and m is 1. In an embodiment, n is 9 and m is 1. In an embodiment, n is 10 and m is 1. In an embodiment, n is 0 and m is 2. In an embodiment, n is 1 and m is 2. In an embodiment, n is 2 and m is 2. In an embodiment, n is 3 and m is 2. In an embodiment, n is 4 and m is 2. In an embodiment, n is 5 and m is 2. In an embodiment, n is 6 and m is 2. In an embodiment, n is 7 and m is 2. In an embodiment, n is 8 and m is 2. In an embodiment, n is 9 and m is 2. In an embodiment, n is 10 and m is 2. In an embodiment, n is 0 and m is 3. In an embodiment, n is 1 and m is 3. In an embodiment, n is 2 and m is 3. In an embodiment, n is 3 and m is 3. In an embodiment, n is 4 and m is 3. In an embodiment, n is 5 and m is 3. In an embodiment, n is 6 and m is 3. In an embodiment, n is 7 and m is 3. In an embodiment, n is 8 and m is 3. In an embodiment, n is 9 and m is 3. In an embodiment, n is 10 and m is 3. In an embodiment, n is 0 and m is 4. In an embodiment, n is 1 and m is 4. In an embodiment, n is 2 and m is 4. In an embodiment, n is 3 and m is 4. In an embodiment, n is 4 and m is 4. In an embodiment, n is 5 and m is 4. In an embodiment, n is 6 and m is 4. In an embodiment, n is 7 and m is 4. In an embodiment, n is 8 and m is 4. In an embodiment, n is 9 and m is 4. In an embodiment, n is 10 and m is 4. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group is a compound of formula (IX):In an embodiment, step a) comprises reacting the saccharide with a carbonic acid derivative followed by reacting the carbonic acid derivative-activated saccharide with an azido linker in an aprotic solvent to produce an activated azido saccharide. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.01-10 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.1-10 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.5-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 1-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 2-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 5-10 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.1-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.5-2 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.01 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.1 molar equivalent to the amount of saccharide present in the reaction mixture.In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.2 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 1 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 2 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 10 molar equivalent to the amount of saccharide present in the reaction mixture. In an embodiment, at step a) the isolated saccharide is reacted with a carbonic acid derivative in an aprotic solvent. In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylsulphoxide (DMSO) or dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylsulphoxide (DMSO). In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylacetamide. In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of N-methyl-2- pyrrolidone. In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of hexamethylphosphoramide (HMPA). In a preferred embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylsulphoxide (DMSO). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in dimethylsulphoxide (DMSO) or dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in dimethylsulphoxide (DMSO).In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in dimethylacetamide. In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in N-methyl-2-pyrrolidone. In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in hexamethylphosphoramide (HMPA). In a preferred embodiment the isolated saccharide is reacted with CDI in dimethylsulphoxide (DMSO). In an embodiment the isolated saccharide is reacted with CDI in anhydrous DMSO. It has been surprisingly found that reacting the isolated saccharide with CDI in an environment with a moisture level of about 0.1% to 1% (v / v) allows to avoid side reactions. Therefore, in one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.6% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.7% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.9% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.6% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.7% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.9% (v / v) water. In one embodiment the free carbonic acid derivative is then quenched by the addition of water before the addition of the azido linker. Water can inactivate free CDI. Therefore, in an embodiment, carbonic acid derivative activation is followed by the addition of water. In an embodiment, water is added to bring the total water content in the mixture to between about 1% to about 10% (v / v). In an embodiment, water is added to bring the total water content in the mixture to between about 1% to about 5% (v / v). In an embodiment, water is added to bring the total water content in the mixture to about 1 % (v / v). In an embodiment, water is added to bring the total water content in the mixture to about 2% (v / v). In an embodiment, water is added to bring the total water content in the mixture to about 5% (v / v). Once the saccharide has been reacted with carbonic acid derivative and following an eventual quenching of carbonic acid derivative with water, the carbonic acid derivative-activated saccharide is reacted with an azido linker. In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of azido linker that is between 0.01-10 molar equivalent to the amount of polysaccharide Repeat Unit of the activated saccharide (molar equivalent of RU). In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of azido linker that is between 0.1-5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of azido linker that is between 0.5-2 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of azido linker that is between 1-5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In the above embodiements, said carbonic acid derivative may be CDI. In another embodiment, said carbonic acid derivative is CDT. In a preferred embodiment, said carbonic acid derivative is DSC (N,N′-Disuccinimidyl carbonate). In one embodiment the degree of activation of the activated saccharide following step a) is between 1.0 to 100%. The degree of activation of the azido saccharide being defined as the percentage of Repeating Unit linked to an azido linker. In one embodiment the degree of activation of the activated saccharide following step a) is between 5 to 70%. In another embodiment the degree of activation of the activated saccharide following step a) is between 5 to 50%. In another embodiment the degree of activation of the activated saccharide following step a) is between 10 to 40%. In another embodiment the degree of activation of the activated saccharide following step a) is between 5 to 15%.In another embodiment the degree of activation of the activated saccharide following step a) is between 15 to 35%. In another embodiment the degree of activation of the activated saccharide following step a) is between 15 to 25%. In an embodiment the degree of activation of the activated saccharide following step a) is about 25%. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is 0.1-10 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is 0.5-10 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is 1-5 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is 2-5 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is 5-10 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is 1-5 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is about 10 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is about 5 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is about 2 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is about 1 molar equivalent to the lysines on the carrier.In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is about 0.5 molar equivalents to the lysines on the carrier. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group that is about 0.1 molar equivalents to the lysines on the carrier. In one embodiment the degree of activation of the activated carrier following step b) is between 1 and 50. The degree of activation of the activated carrier being defined as the number of lysine residues in the carrier protein that become linked to the agent bearing an N- Hydroxysuccinimide (NHS) moiety and an alkyne group . In an embodiment, the carrier protein is CRM197, which contains 39 lysine residues. In said embodiment the degree of activation of the activated carrier following step b) may be between 1 to 30. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 5 to 20. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 9 to 18. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 8 to 11. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 15 to 20. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 5. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 6. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 7. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 8. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 9. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 10. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 11. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 12. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 13. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 14. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 15. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 16. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 17. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 18. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 19. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 20. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 21. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 22. In anotherembodiment the degree of activation of the activated carrier (CRM197) following step b) is about 23. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 24. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 25. In an embodiment, the carrier protein is SCP or a fragment thereof. In said embodiment the degree of activation of the activated carrier following step b) may be between 1 to 50. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 5 to 50. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 7 to 45. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 5 to 25. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 10 to 25. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 17 to 22. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 5. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 7. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 10. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 13. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 15. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 20. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 26. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 30. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 35. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 37. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 40. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 45. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 50. In an embodiment, the carrier protein is TT or a fragment thereof. In said embodiment the degree of activation of the activated carrier following step b) may be between 1 to 30. In another embodiment the degree of activation of the activated carrier (TT) following step b) is between 5 to 25. In another embodiment the degree of activation of the activated carrier (TT) following step b) is between 7 to 25. In another embodiment the degree of activation of the activated carrier (TT) following step b) is between 10 to 20. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 5. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 7. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 10. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 12. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 15. Inanother embodiment the degree of activation of the activated carrier (TT) following step b) is about 20. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 25. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 30. In an embodiment, the conjugation reaction c) is carried out in aqueous buffer. In an embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence of copper (I) as catalyst. In an embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence an oxidant and of copper (I) as catalyst. In a preferred embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence of copper (I) as catalyst and ascorbate as oxidant. In an embodiment, THPTA (tris(3-hydroxypropyltriazolylmethyl)amine) and aminoguanidine may be further added to protect the protein from side reactions. Therefore, in a preferred embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence of copper (I) as catalyst and ascorbate as oxidant, wherein the reaction mixture further comprises THPTA (tris(3-hydroxypropyltriazolylmethyl)amine) and aminoguanidine. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is between 0.1 and 3. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is between 0.5 and 2. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is between 0.6 and 1.5. In a preferred embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is between 0.8 and 1. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 0.5. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 0.6. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 0.7. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 0.8. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 0.9. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.1. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.2. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.3. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.4. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.5. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.6. In an embodiment the initial input ratio (weight by weight) ofactivated azido saccharide to activated alkyne-carrier at setp c) is about 1.7. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.8. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 1.9. In an embodiment the initial input ratio (weight by weight) of activated azido saccharide to activated alkyne-carrier at setp c) is about 2. Following the click conjugation reaction, there may remain unreacted azido groups in the conjugates, these may be capped using a suitable azido group capping agent. Therefore, in an embodiment, following step c), unreacted azido groups in the conjugates, are capped using a suitable azido group capping agent. In one embodiment this azido group capping agent is an agent bearing an alkyne group. In one embodiment this azido group capping agent is an agent bearing a terminal alkyne. In one embodiment this azido group capping agent is an agent bearing a cycloalkyne. In an embodiment, said azido group capping agent is a compound of formula (X), (X) wherein X is (CH2)nwherein n is selected from 1 to 15. In one embodiment this azido group capping agent is propargyl alcohol. Therefore, in an embodiment, following step (c) the process further comprises a step of capping the unreacted azido groups remained in the conjugates with an azido group capping agent. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.05 to 20 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.1 to 15 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 10 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide.In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 1 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 1 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.75 to 1.5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 1 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 1.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 0.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. Following the click conjugation reaction, unreacted alkyne groups may remain present in the conjugates, these may be capped using a suitable alkyne group capping agent. In one embodiment this alkyne group capping agent is an agent bearing an azido group. In an embodiment, said alkyne group capping agent is a compound of formula (XI), (XI) wherein X is (CH2)nwherein n is selected from 1 to 15. In one embodiment this alkyne group capping agent is 3-azido-1-propanol. Therefore, in an embodiment, following step (c) the process further comprises a step of capping the unreacted alkyne groups remained in the conjugates with an alkyne group capping agent. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.05 to 20 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.1 to 15 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide.In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 10 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 1 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 1 to 5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 1 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 1.5 to 2.5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 0.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 1 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 1.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 2.5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide.In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. Following conjugation to the carrier protein, the glycoconjugate can be purified (enriched with respect to the amount of saccharide-protein conjugate) by a variety of techniques known to the skilled person. These techniques include dialysis, concentration / diafiltration operations, tangential flow filtration precipitation / elution, column chromatography (DEAE or hydrophobic interaction chromatography), and depth filtration. Therefore, in one embodiment the process for producing the glycoconjugate of the present invention comprises the step of purifying the glycoconjugate after it is produced. In an aspect, the invention provides a serotype 9N glycoconjugate produced according to any of the methods disclosed herein. Alternative click chemistry In an embodiment of the present invention, the serotype 9N glycoconjugate of the present invention is prepared by alternative click chemistry as disclosed e.g. US Provisional App. No. 63 / 484,228 (filed on February 10, 2023). Therefore, in an embodiment, the serotype 9N glycoconjugate of the present invention comprises a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII):(XII), wherein X is selected from the group consisting of CH2(CH2)n’, (CH2CH2O)mCH2CH2, NHCO(CH2)n’, NHCO(CH2CH2O)mCH2CH2, OCH2(CH2)n’and O(CH2CH2O)mCH2CH2; where n’ is selected from 0 to 10 and m is selected from 1 to 4, and wherein X' is selected from the group consisting of CH2(CH2)n”,CH2O(CH2)n’’CH2, CH2O(CH2CH2O)m’(CH2)n’’CH2, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4, wherein the structure in square backet represents a repeat unit of the serotype 9N saccharide and wherein n represents the number of repeating units. In a preferred embodiement, the invention is directed to a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through aspacer and having the general formula (XII), wherein X is CH2(CH2)n’, where n’ is 0 and wherein X' is CH2(CH2)n”where n’’ is 0. Therefore, in a preferred embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XIII),(XIII). wherein the structure in square backet represents a repeat unit of the serotype 9N saccharide and wherein n represents the number of repeating units. Formulas (XII) and (XIII) are a schematic representation of glycoconjugates of the invention. It should not be understood that a linkage is present at every repeat unit of the saccharide (the structure in square brackets). Rather, a majority of the saccharide repeating unit remains unmodified and covalent linkages between the carrier protein and the saccharide is for a minority of the saccharide repeat units. Additionally, an individual carrier protein (CP) molecule may be linked to more than one saccharide molecule and an individual saccharide molecule can be linked to more than one individual carrier protein (CP) molecule. The structure in square brackets is a schematic representation of a repeat unit of the serotype 9N saccharide. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is CH2(CH2)n’, where n’ is selected from 0 to 10 and wherein X' is CH2(CH2)n”where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 0 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 0 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 0 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 0 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 0 and n’’ is 0. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is à and n’’ is 1. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1 and n’’ is 2. In anotherembodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 0 and n’’ is 6. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is CH2(CH2)n’, where n’ is selected from 0 to 10 and wherein X' is CH2O(CH2)n’’CH2where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 0 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 0 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 0 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 0 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 0 and n’’ is 0. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is à and n’’ is 1. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particularembodiment, n’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 0 and n’’ is 6. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is CH2(CH2)n’, where n’ is selected from 0 to 10 and wherein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, n’ is selected from 0 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 0 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 0 to 3, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 0 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In an embodiment, n’ is selected from 0 to 1, m’ is selected from 0 to 1 and n’’ is selected from 0 to 1. In a particular embodiment, n’ is 0, m’ is 0 and n’’ is 0. In another embodiment, n’ is 0, m’ is 1 and n’’ is 0. In another embodiment, n’ is 0, m’ is 2 and n’’ is 0. In another embodiment, n’ is 1, m’ is 3 and n’’ is 0. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 0. In another embodiment, n’ is 1, m’ is 1 and n’’ is 0. In another embodiment, n’ is 1, m’ is 2 and n’’ is 0. In another embodiment, n’ is 1, m’ is 3 and n’’ is 0. In another embodiment, n’ is 2, m’ is 0 and n’’ is 0. In another embodiment, n’ is 2, m’ is 1 and n’’ is 0. In another embodiment, n’ is 2, m’ is 2 and n’’ is 0. In another embodiment, n’ is 2, m’ is 3 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 0.In yet a further embodiment, n’ is 5, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 0.In yet a further embodiment, n’ is 5, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 0. In a particular embodiment, n’ is 0, m’ is 0 and n’’ is 1. In a particular embodiment, n’ is 0, m’ is 1 and n’’ is 1. In a particular embodiment, n’ is 0, m’ is 2 and n’’ is 1. In a particular embodiment, n’ is 0, m’ is 3 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 1. In another embodiment, n’ is 2, m’ is 0 and n’’ is 1. In another embodiment, n’ is 2, m’ is 1 and n’’ is 1. In another embodiment, n’ is 2, m’ is 2 and n’’ is 1. In another embodiment, n’ is 2, m’ is 3 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 1. In a particular embodiment, n’ is 0, m’ is 0 and n’’ is 2. In a particular embodiment, n’ is 0, m’ is 1 and n’’ is 2. In a particular embodiment, n’ is 0, m’ is 2 and n’’ is 2. In a particular embodiment, n’ is 0, m’ is 3 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 2. In another embodiment, n’ is 2, m’ is 0 and n’’ is 2. In another embodiment, n’ is 2, m’ is 1 and n’’ is 2. In another embodiment, n’ is 2, m’ is 2 and n’’ is 2. In another embodiment, n’ is 2, m’ is 3 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 2.In yet a further embodiment, n’ is 5, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 2. In a particular embodiment, n’ is 0, m’ is 0 and n’’ is 3. In a particular embodiment, n’ is 0, m’ is 1 and n’’ is 3. In a particular embodiment, n’ is 0, m’ is 2 and n’’ is 3. In a particular embodiment, n’ is 0, m’ is 3 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 3. In another embodiment, n’ is 2, m’ is 0 and n’’ is 3. In another embodiment, n’ is 2, m’ is 1 and n’’ is 3. In another embodiment, n’ is 2, m’ is 2 and n’’ is 3. In another embodiment, n’ is 2, m’ is 3 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 3. In a particular embodiment, n’ is 0, m’ is 0 and n’’ is 4. In a particular embodiment, n’ is 0, m’ is 1 and n’’ is 4. In a particular embodiment, n’ is 0, m’ is 2 and n’’ is 4. In a particular embodiment, n’ is 0, m’ is 3 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 4. In another embodiment, n’ is 2, m’ is 0 and n’’ is 4. In another embodiment, n’ is 2, m’ is 1 and n’’ is 4. In another embodiment, n’ is 2, m’ is 2 and n’’ is 4. In another embodiment, n’ is 2, m’ is 3 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 4.In yet a further embodiment, n’ is 5, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 4. In a particular embodiment, n’ is 0, m’ is 0 and n’’ is 5. In a particular embodiment, n’ is 0, m’ is 1 and n’’ is 5. In a particular embodiment, n’ is 0, m’ is 2 and n’’ is 5. In a particular embodiment, n’ is 0, m’ is 3 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 5. In another embodiment, n’ is 2, m’ is 0 and n’’ is 5. In another embodiment, n’ is 2, m’ is 1 and n’’ is 5. In another embodiment, n’ is 2, m’ is 2 and n’’ is 5. In another embodiment, n’ is 2, m’ is 3 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is (CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2(CH2)n”, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In aparticular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is (CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2)n’’CH2, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In a particular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is (CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, m is selected from 1 to 3, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 0. In another embodiment, m is 1, m’ is 1 and n’’ is 0. In another embodiment, m is 1, m’ is 2 and n’’ is 0. In another embodiment, m is 1, m’ is 3 and n’’ is 0.In another embodiment, m is 2, m’ is 0 and n’’ is 0. In another embodiment, m is 2, m’ is 1 and n’’ is 0. In another embodiment, m is 2, m’ is 2 and n’’ is 0. In another embodiment, m is 2, m’ is 3 and n’’ is 0. In yet another embodiment, m is 3, m’ is 0 and n’’ is 0. In yet another embodiment, m is 3, m’ is 1 and n’’ is 0. In yet another embodiment, m is 3, m’ is 2 and n’’ is 0. In yet another embodiment, m is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, m is 4, m’ is 0 and n” is 0. In yet a further embodiment, m is 4, m’ is 1 and n” is 0. In yet a further embodiment, m is 4, m’ is 2 and n” is 0. In yet a further embodiment, m is 4, m’ is 3 and n” is 0. In a particular embodiment, m is 1, m’ is 0 and n’’ is 1. In a particular embodiment, m is 1, m’ is 1 and n’’ is 1. In a particular embodiment, m is 1, m’ is 2 and n’’ is 1. In a particular embodiment, m is 1, m’ is 3 and n’’ is 1. In another embodiment, m is 2, m’ is 0 and n’’ is 1. In another embodiment, m is 2, m’ is 1 and n’’ is 1. In another embodiment, m is 2, m’ is 2 and n’’ is 1. In another embodiment, m is 2, m’ is 3 and n’’ is 1. In yet another embodiment, m is 3, m’ is 0 and n’’ is 1. In yet another embodiment, m is 3, m’ is 1 and n’’ is 1. In yet another embodiment, m is 3, m’ is 2 and n’’ is 1. In yet another embodiment, m is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, m is 4, m’ is 0 and n” is 1. In yet a further embodiment, m is 4, m’ is 1 and n” is 1. In yet a further embodiment, m is 4, m’ is 2 and n” is 1. In yet a further embodiment, m is 4, m’ is 3 and n” is 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 2. In a particular embodiment, m is 1, m’ is 1 and n’’ is 2. In a particular embodiment, m is 1, m’ is 2 and n’’ is 2. In a particular embodiment, m is 1, m’ is 3 and n’’ is 2. In another embodiment, m is 2, m’ is 0 and n’’ is 2. In another embodiment, m is 2, m’ is 1 and n’’ is 2. In another embodiment, m is 2, m’ is 2 and n’’ is 2. In another embodiment, m is 2, m’ is 3 and n’’ is 2. In yet another embodiment, m is 3, m’ is 0 and n’’ is 2. In yet another embodiment, m is 3, m’ is 1 and n’’ is 2. In yet another embodiment, m is 3, m’ is 2 and n’’ is 2. In yet another embodiment, m is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, m is 4, m’ is 0 and n” is 2. In yet a further embodiment, m is 4, m’ is 1 and n” is 2. In yet a further embodiment, m is 4, m’ is 2 and n” is 2. In yet a further embodiment, m is 4, m’ is 3 and n” is 2. In a particular embodiment, m is 1, m’ is 0 and n’’ is 3. In a particular embodiment, m is 1, m’ is 1 and n’’ is 3. In a particular embodiment, m is 1, m’ is 2 and n’’ is 3. In a particular embodiment, m is 1, m’ is 3 and n’’ is 3.In another embodiment, m is 2, m’ is 0 and n’’ is 3. In another embodiment, m is 2, m’ is 1 and n’’ is 3. In another embodiment, m is 2, m’ is 2 and n’’ is 3. In another embodiment, m is 2, m’ is 3 and n’’ is 3. In yet another embodiment, m is 3, m’ is 0 and n’’ is 3. In yet another embodiment, m is 3, m’ is 1 and n’’ is 3. In yet another embodiment, m is 3, m’ is 2 and n’’ is 3. In yet another embodiment, m is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, m is 4, m’ is 0 and n” is 3. In yet a further embodiment, m is 4, m’ is 1 and n” is 3. In yet a further embodiment, m is 4, m’ is 2 and n” is 3. In yet a further embodiment, m is 4, m’ is 3 and n” is 3. In a particular embodiment, m is 1, m’ is 0 and n’’ is 4. In a particular embodiment, m is 1, m’ is 1 and n’’ is 4. In a particular embodiment, m is 1, m’ is 2 and n’’ is 4. In a particular embodiment, m is 1, m’ is 3 and n’’ is 4. In another embodiment, m is 2, m’ is 0 and n’’ is 4. In another embodiment, m is 2, m’ is 1 and n’’ is 4. In another embodiment, m is 2, m’ is 2 and n’’ is 4. In another embodiment, m is 2, m’ is 3 and n’’ is 4. In yet another embodiment, m is 3, m’ is 0 and n’’ is 4. In yet another embodiment, m is 3, m’ is 1 and n’’ is 4. In yet another embodiment, m is 3, m’ is 2 and n’’ is 4. In yet another embodiment, m is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, m is 4, m’ is 0 and n” is 4. In yet a further embodiment, m is 4, m’ is 1 and n” is 4. In yet a further embodiment, m is 4, m’ is 2 and n” is 4. In yet a further embodiment, m is 4, m’ is 3 and n” is 4. In a particular embodiment, m is 1, m’ is 0 and n’’ is 5. In a particular embodiment, m is 1, m’ is 1 and n’’ is 5. In a particular embodiment, m is 1, m’ is 2 and n’’ is 5. In a particular embodiment, m is 1, m’ is 3 and n’’ is 5. In another embodiment, m is 2, m’ is 0 and n’’ is 5. In another embodiment, m is 2, m’ is 1 and n’’ is 5. In another embodiment, m is 2, m’ is 2 and n’’ is 5. In another embodiment, m is 2, m’ is 3 and n’’ is 5. In yet another embodiment, m is 3, m’ is 0 and n’’ is 5. In yet another embodiment, m is 3, m’ is 1 and n’’ is 5. In yet another embodiment, m is 3, m’ is 2 and n’’ is 5. In yet another embodiment, m is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, m is 4, m’ is 0 and n” is 5. In yet a further embodiment, m is 4, m’ is 1 and n” is 5. In yet a further embodiment, m is 4, m’ is 2 and n” is 5. In yet a further embodiment, m is 4, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is NHCO(CH2)n’, where n’ is selected from 1 to 10 and wherein X' is CH2(CH2)n”, where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ isselected from 0 to 5. In an embodiment, n’ is selected from 1 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (VII), wherein X is NHCO(CH2)n’, where n’ is selected from 1 to 10 and wherein X' is CH2O(CH2)n’’CH2, where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a furtherembodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is NHCO(CH2)n’, where n’ is selected from 1 to 10 and wherein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 0. In another embodiment, n’ is 1, m’ is 1 and n’’ is 0. In another embodiment, n’ is 1, m’ is 2 and n’’ is 0. In another embodiment, n’ is 1, m’ is 3 and n’’ is 0. In another embodiment, n’ is 2, m’ is 0 and n’’ is 0. In another embodiment, n’ is 2, m’ is 1 and n’’ is 0. In another embodiment, n’ is 2, m’ is 2 and n’’ is 0. In another embodiment, n’ is 2, m’ is 3 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 0.In yet a further embodiment, n’ is 5, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 0.In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 1. In another embodiment, n’ is 2, m’ is 0 and n’’ is 1. In another embodiment, n’ is 2, m’ is 1 and n’’ is 1. In another embodiment, n’ is 2, m’ is 2 and n’’ is 1. In another embodiment, n’ is 2, m’ is 3 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 2. In another embodiment, n’ is 2, m’ is 0 and n’’ is 2. In another embodiment, n’ is 2, m’ is 1 and n’’ is 2. In another embodiment, n’ is 2, m’ is 2 and n’’ is 2. In another embodiment, n’ is 2, m’ is 3 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 2. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 3. In another embodiment, n’ is 2, m’ is 0 and n’’ is 3. In another embodiment, n’ is 2, m’ is 1 and n’’ is 3. In another embodiment, n’ is 2, m’ is 2 and n’’ is 3. In another embodiment, n’ is 2, m’ is 3 and n’’ is 3.In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 3. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 4. In another embodiment, n’ is 2, m’ is 0 and n’’ is 4. In another embodiment, n’ is 2, m’ is 1 and n’’ is 4. In another embodiment, n’ is 2, m’ is 2 and n’’ is 4. In another embodiment, n’ is 2, m’ is 3 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 4. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 5. In another embodiment, n’ is 2, m’ is 0 and n’’ is 5. In another embodiment, n’ is 2, m’ is 1 and n’’ is 5. In another embodiment, n’ is 2, m’ is 2 and n’’ is 5. In another embodiment, n’ is 2, m’ is 3 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 5.In yet a further embodiment, n’ is 5, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is NHCO(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2(CH2)n”, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In a particular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is NHCO(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2)n’’CH2, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yetanother embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In a particular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is NHCO(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, m is selected from 1 to 3, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 0. In another embodiment, m is 1, m’ is 1 and n’’ is 0. In another embodiment, m is 1, m’ is 2 and n’’ is 0. In another embodiment, m is 1, m’ is 3 and n’’ is 0. In another embodiment, m is 2, m’ is 0 and n’’ is 0. In another embodiment, m is 2, m’ is 1 and n’’ is 0. In another embodiment, m is 2, m’ is 2 and n’’ is 0. In another embodiment, m is 2, m’ is 3 and n’’ is 0. In yet another embodiment, m is 3, m’ is 0 and n’’ is 0. In yet another embodiment, m is 3, m’ is 1 and n’’ is 0. In yet another embodiment, m is 3, m’ is 2 and n’’ is 0. In yet another embodiment, m is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, m is 4, m’ is 0 and n” is 0. In yet a further embodiment, m is 4, m’ is 1 and n” is 0. In yet a further embodiment, m is 4, m’ is 2 and n” is 0. In yet a further embodiment, m is 4, m’ is 3 and n” is 0. In a particular embodiment, m is 1, m’ is 0 and n’’ is 1. In a particular embodiment, m is 1, m’ is 1 and n’’ is 1. In a particular embodiment, m is 1, m’ is 2 and n’’ is 1. In a particular embodiment, m is 1, m’ is 3 and n’’ is 1. In another embodiment, m is 2, m’ is 0 and n’’ is 1. In another embodiment, m is 2, m’ is 1 and n’’ is 1. In another embodiment, m is 2, m’ is 2 and n’’ is 1. In another embodiment, m is 2, m’ is 3 and n’’ is 1. In yet another embodiment, m is 3, m’ is 0 and n’’ is 1. In yet another embodiment, m is 3, m’ is 1 and n’’ is 1. In yet another embodiment, m is 3, m’ is 2 and n’’ is 1. In yet another embodiment, m is 3, m’ is 3 and n’’ is 1.In yet a further embodiment, m is 4, m’ is 0 and n” is 1. In yet a further embodiment, m is 4, m’ is 1 and n” is 1. In yet a further embodiment, m is 4, m’ is 2 and n” is 1. In yet a further embodiment, m is 4, m’ is 3 and n” is 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 2. In a particular embodiment, m is 1, m’ is 1 and n’’ is 2. In a particular embodiment, m is 1, m’ is 2 and n’’ is 2. In a particular embodiment, m is 1, m’ is 3 and n’’ is 2. In another embodiment, m is 2, m’ is 0 and n’’ is 2. In another embodiment, m is 2, m’ is 1 and n’’ is 2. In another embodiment, m is 2, m’ is 2 and n’’ is 2. In another embodiment, m is 2, m’ is 3 and n’’ is 2. In yet another embodiment, m is 3, m’ is 0 and n’’ is 2. In yet another embodiment, m is 3, m’ is 1 and n’’ is 2. In yet another embodiment, m is 3, m’ is 2 and n’’ is 2. In yet another embodiment, m is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, m is 4, m’ is 0 and n” is 2. In yet a further embodiment, m is 4, m’ is 1 and n” is 2. In yet a further embodiment, m is 4, m’ is 2 and n” is 2. In yet a further embodiment, m is 4, m’ is 3 and n” is 2. In a particular embodiment, m is 1, m’ is 0 and n’’ is 3. In a particular embodiment, m is 1, m’ is 1 and n’’ is 3. In a particular embodiment, m is 1, m’ is 2 and n’’ is 3. In a particular embodiment, m is 1, m’ is 3 and n’’ is 3. In another embodiment, m is 2, m’ is 0 and n’’ is 3. In another embodiment, m is 2, m’ is 1 and n’’ is 3. In another embodiment, m is 2, m’ is 2 and n’’ is 3. In another embodiment, m is 2, m’ is 3 and n’’ is 3. In yet another embodiment, m is 3, m’ is 0 and n’’ is 3. In yet another embodiment, m is 3, m’ is 1 and n’’ is 3. In yet another embodiment, m is 3, m’ is 2 and n’’ is 3. In yet another embodiment, m is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, m is 4, m’ is 0 and n” is 3. In yet a further embodiment, m is 4, m’ is 1 and n” is 3. In yet a further embodiment, m is 4, m’ is 2 and n” is 3. In yet a further embodiment, m is 4, m’ is 3 and n” is 3. In a particular embodiment, m is 1, m’ is 0 and n’’ is 4. In a particular embodiment, m is 1, m’ is 1 and n’’ is 4. In a particular embodiment, m is 1, m’ is 2 and n’’ is 4. In a particular embodiment, m is 1, m’ is 3 and n’’ is 4. In another embodiment, m is 2, m’ is 0 and n’’ is 4. In another embodiment, m is 2, m’ is 1 and n’’ is 4. In another embodiment, m is 2, m’ is 2 and n’’ is 4. In another embodiment, m is 2, m’ is 3 and n’’ is 4. In yet another embodiment, m is 3, m’ is 0 and n’’ is 4. In yet another embodiment, m is 3, m’ is 1 and n’’ is 4. In yet another embodiment, m is 3, m’ is 2 and n’’ is 4. In yet another embodiment, m is 3, m’ is 3 and n’’ is 4.In yet a further embodiment, m is 4, m’ is 0 and n” is 4. In yet a further embodiment, m is 4, m’ is 1 and n” is 4. In yet a further embodiment, m is 4, m’ is 2 and n” is 4. In yet a further embodiment, m is 4, m’ is 3 and n” is 4. In a particular embodiment, m is 1, m’ is 0 and n’’ is 5. In a particular embodiment, m is 1, m’ is 1 and n’’ is 5. In a particular embodiment, m is 1, m’ is 2 and n’’ is 5. In a particular embodiment, m is 1, m’ is 3 and n’’ is 5. In another embodiment, m is 2, m’ is 0 and n’’ is 5. In another embodiment, m is 2, m’ is 1 and n’’ is 5. In another embodiment, m is 2, m’ is 2 and n’’ is 5. In another embodiment, m is 2, m’ is 3 and n’’ is 5. In yet another embodiment, m is 3, m’ is 0 and n’’ is 5. In yet another embodiment, m is 3, m’ is 1 and n’’ is 5. In yet another embodiment, m is 3, m’ is 2 and n’’ is 5. In yet another embodiment, m is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, m is 4, m’ is 0 and n” is 5. In yet a further embodiment, m is 4, m’ is 1 and n” is 5. In yet a further embodiment, m is 4, m’ is 2 and n” is 5. In yet a further embodiment, m is 4, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is OCH2(CH2)n’, where n’ is selected from 1 to 10 and wherein X' is CH2(CH2)n”, where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yetanother embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is OCH2(CH2)n’, where n’ is selected from 1 to 10 and wherein X' is CH2O(CH2)n’’CH2, where n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, n’ is 1 and n’’ is 0. In another embodiment, n’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4 and n” is 0. In yet a further embodiment, n’ is 5 and n” is 0. In yet a further embodiment, n’ is 6 and n” is 0. In a particular embodiment, n’ is 1 and n’’ is 1. In another embodiment, n’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4 and n” is 1. In yet a further embodiment, n’ is 5 and n” is 1. In yet a further embodiment, n’ is 6 and n” is 1. In a particular embodiment, n’ is 1 and n’’ is 2. In another embodiment, n’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4 and n” is 2. In yet a further embodiment, n’ is 5 and n” is 2. In yet a further embodiment, n’ is 6 and n” is 2. In a particular embodiment, n’ is 1 and n’’ is 3. In another embodiment, n’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4 and n” is 3. In yet a further embodiment, n’ is 5 and n” is 3. In yet a further embodiment, n’ is 6 and n” is 3. In a particular embodiment, n’ is 1 and n’’ is 4. In another embodiment, n’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3 and n’’ is 4. In yet a further embodiment, n’ is 4 and n” is 4. In yet a further embodiment, n’ is 5 and n” is 4. In yet a further embodiment, n’ is 6 and n” is 4. In a particular embodiment, n’ is 1 and n’’ is 5. In another embodiment, n’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4 and n” is 5. In yet a further embodiment, n’ is 5 and n” is 5. In yet a further embodiment, n’ is 6 and n” is 5. In a particular embodiment, n’ is 1 and n’’ is 6. In another embodiment, n’ is 2 and n’’ is 6. In yet another embodiment, n’ is 3 and n’’ is 6. In yet a further embodiment, n’ is 4 and n” is 6. In yet a further embodiment, n’ is 5 and n” is 6. In yet a further embodiment, n’ is 6 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is OCH2(CH2)n’, where n’ is selected from 1 to 10 and wherein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4.In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, n’ is selected from 1 to 5, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, n’ is selected from 1 to 3, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, n’ is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 0. In another embodiment, n’ is 1, m’ is 1 and n’’ is 0. In another embodiment, n’ is 1, m’ is 2 and n’’ is 0. In another embodiment, n’ is 1, m’ is 3 and n’’ is 0. In another embodiment, n’ is 2, m’ is 0 and n’’ is 0. In another embodiment, n’ is 2, m’ is 1 and n’’ is 0. In another embodiment, n’ is 2, m’ is 2 and n’’ is 0. In another embodiment, n’ is 2, m’ is 3 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 0. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 0.In yet a further embodiment, n’ is 5, m’ is 2 and n” is 0. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 0. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 1. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 1. In another embodiment, n’ is 2, m’ is 0 and n’’ is 1. In another embodiment, n’ is 2, m’ is 1 and n’’ is 1. In another embodiment, n’ is 2, m’ is 2 and n’’ is 1. In another embodiment, n’ is 2, m’ is 3 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 1. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 1. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 1. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 2. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 2.In another embodiment, n’ is 2, m’ is 0 and n’’ is 2. In another embodiment, n’ is 2, m’ is 1 and n’’ is 2. In another embodiment, n’ is 2, m’ is 2 and n’’ is 2. In another embodiment, n’ is 2, m’ is 3 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 2. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 2. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 2. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 3. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 3. In another embodiment, n’ is 2, m’ is 0 and n’’ is 3. In another embodiment, n’ is 2, m’ is 1 and n’’ is 3. In another embodiment, n’ is 2, m’ is 2 and n’’ is 3. In another embodiment, n’ is 2, m’ is 3 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 3. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 3. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 3. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 4. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 4. In another embodiment, n’ is 2, m’ is 0 and n’’ is 4. In another embodiment, n’ is 2, m’ is 1 and n’’ is 4. In another embodiment, n’ is 2, m’ is 2 and n’’ is 4. In another embodiment, n’ is 2, m’ is 3 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 4. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 4.In yet a further embodiment, n’ is 4, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 4. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 4. In a particular embodiment, n’ is 1, m’ is 0 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 1 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 2 and n’’ is 5. In a particular embodiment, n’ is 1, m’ is 3 and n’’ is 5. In another embodiment, n’ is 2, m’ is 0 and n’’ is 5. In another embodiment, n’ is 2, m’ is 1 and n’’ is 5. In another embodiment, n’ is 2, m’ is 2 and n’’ is 5. In another embodiment, n’ is 2, m’ is 3 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 0 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 1 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 2 and n’’ is 5. In yet another embodiment, n’ is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, n’ is 4, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 4, m’ is 3 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 0 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 1 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 2 and n” is 5. In yet a further embodiment, n’ is 5, m’ is 3 and n” is 5. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is O(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2(CH2)n”, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In aparticular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is O(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2)n’’CH2, where n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 3 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2 and n’’ is selected from 0 to 2. In a particular embodiment, m is 1 and n’’ is 0. In another embodiment, m is 2 and n’’ is 0. In yet another embodiment, m is 3 and n’’ is 0. In yet a further embodiment, m is 4 and n” is 0. In a particular embodiment, m is 1 and n’’ is 1. In another embodiment, m is 2 and n’’ is 1. In yet another embodiment, m is 3 and n’’ is 1. In yet a further embodiment, m is 4 and n” is 1. In a particular embodiment, m is 1 and n’’ is 2. In another embodiment, m is 2 and n’’ is 2. In yet another embodiment, m is 3 and n’’ is 2. In yet a further embodiment, m is 4 and n” is 2. In a particular embodiment, m is 1 and n’’ is 3. In another embodiment, m is 2 and n’’ is 3. In yet another embodiment, m is 3 and n’’ is 3. In yet a further embodiment, m is 4 and n” is 3. In a particular embodiment, m is 1 and n’’ is 4. In another embodiment, m is 2 and n’’ is 4. In yet another embodiment, m is 3 and n’’ is 4. In yet a further embodiment, m is 4 and n” is 4. In a particular embodiment, m is 1 and n’’ is 5. In another embodiment, m is 2 and n’’ is 5. In yet another embodiment, m is 3 and n’’ is 5. In yet a further embodiment, m is 4 and n” is 5. In a particular embodiment, m is 1 and n’’ is 6. In another embodiment, m is 2 and n’’ is 6. In yet another embodiment, m is 3 and n’’ is 6. In yet a further embodiment, m is 4 and n” is 6. In an embodiment, the invention provides a serotype 9N glycoconjugate comprising a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XII), wherein X is O(CH2CH2O)mCH2CH2, where m is selected from 1 to 4 and wherein X' is CH2O(CH2CH2O)m’(CH2)n’’CH2, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4. In an embodiment, m is selected from 1 to 3, m’ is selected from 0 to 4 and n’’ is selected from 0 to 10. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 4 and n’’ is selected from 0 to 5. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 3. In an embodiment, m is selected from 1 to 2, m’ is selected from 0 to 2 and n’’ is selected from 0 to 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 0. In another embodiment, m is 1, m’ is 1 and n’’ is 0. In another embodiment, m is 1, m’ is 2 and n’’ is 0. In another embodiment, m is 1, m’ is 3 and n’’ is 0.In another embodiment, m is 2, m’ is 0 and n’’ is 0. In another embodiment, m is 2, m’ is 1 and n’’ is 0. In another embodiment, m is 2, m’ is 2 and n’’ is 0. In another embodiment, m is 2, m’ is 3 and n’’ is 0. In yet another embodiment, m is 3, m’ is 0 and n’’ is 0. In yet another embodiment, m is 3, m’ is 1 and n’’ is 0. In yet another embodiment, m is 3, m’ is 2 and n’’ is 0. In yet another embodiment, m is 3, m’ is 3 and n’’ is 0. In yet a further embodiment, m is 4, m’ is 0 and n” is 0. In yet a further embodiment, m is 4, m’ is 1 and n” is 0. In yet a further embodiment, m is 4, m’ is 2 and n” is 0. In yet a further embodiment, m is 4, m’ is 3 and n” is 0. In a particular embodiment, m is 1, m’ is 0 and n’’ is 1. In a particular embodiment, m is 1, m’ is 1 and n’’ is 1. In a particular embodiment, m is 1, m’ is 2 and n’’ is 1. In a particular embodiment, m is 1, m’ is 3 and n’’ is 1. In another embodiment, m is 2, m’ is 0 and n’’ is 1. In another embodiment, m is 2, m’ is 1 and n’’ is 1. In another embodiment, m is 2, m’ is 2 and n’’ is 1. In another embodiment, m is 2, m’ is 3 and n’’ is 1. In yet another embodiment, m is 3, m’ is 0 and n’’ is 1. In yet another embodiment, m is 3, m’ is 1 and n’’ is 1. In yet another embodiment, m is 3, m’ is 2 and n’’ is 1. In yet another embodiment, m is 3, m’ is 3 and n’’ is 1. In yet a further embodiment, m is 4, m’ is 0 and n” is 1. In yet a further embodiment, m is 4, m’ is 1 and n” is 1. In yet a further embodiment, m is 4, m’ is 2 and n” is 1. In yet a further embodiment, m is 4, m’ is 3 and n” is 1. In a particular embodiment, m is 1, m’ is 0 and n’’ is 2. In a particular embodiment, m is 1, m’ is 1 and n’’ is 2. In a particular embodiment, m is 1, m’ is 2 and n’’ is 2. In a particular embodiment, m is 1, m’ is 3 and n’’ is 2. In another embodiment, m is 2, m’ is 0 and n’’ is 2. In another embodiment, m is 2, m’ is 1 and n’’ is 2. In another embodiment, m is 2, m’ is 2 and n’’ is 2. In another embodiment, m is 2, m’ is 3 and n’’ is 2. In yet another embodiment, m is 3, m’ is 0 and n’’ is 2. In yet another embodiment, m is 3, m’ is 1 and n’’ is 2. In yet another embodiment, m is 3, m’ is 2 and n’’ is 2. In yet another embodiment, m is 3, m’ is 3 and n’’ is 2. In yet a further embodiment, m is 4, m’ is 0 and n” is 2. In yet a further embodiment, m is 4, m’ is 1 and n” is 2. In yet a further embodiment, m is 4, m’ is 2 and n” is 2. In yet a further embodiment, m is 4, m’ is 3 and n” is 2. In a particular embodiment, m is 1, m’ is 0 and n’’ is 3. In a particular embodiment, m is 1, m’ is 1 and n’’ is 3. In a particular embodiment, m is 1, m’ is 2 and n’’ is 3. In a particular embodiment, m is 1, m’ is 3 and n’’ is 3.In another embodiment, m is 2, m’ is 0 and n’’ is 3. In another embodiment, m is 2, m’ is 1 and n’’ is 3. In another embodiment, m is 2, m’ is 2 and n’’ is 3. In another embodiment, m is 2, m’ is 3 and n’’ is 3. In yet another embodiment, m is 3, m’ is 0 and n’’ is 3. In yet another embodiment, m is 3, m’ is 1 and n’’ is 3. In yet another embodiment, m is 3, m’ is 2 and n’’ is 3. In yet another embodiment, m is 3, m’ is 3 and n’’ is 3. In yet a further embodiment, m is 4, m’ is 0 and n” is 3. In yet a further embodiment, m is 4, m’ is 1 and n” is 3. In yet a further embodiment, m is 4, m’ is 2 and n” is 3. In yet a further embodiment, m is 4, m’ is 3 and n” is 3. In a particular embodiment, m is 1, m’ is 0 and n’’ is 4. In a particular embodiment, m is 1, m’ is 1 and n’’ is 4. In a particular embodiment, m is 1, m’ is 2 and n’’ is 4. In a particular embodiment, m is 1, m’ is 3 and n’’ is 4. In another embodiment, m is 2, m’ is 0 and n’’ is 4. In another embodiment, m is 2, m’ is 1 and n’’ is 4. In another embodiment, m is 2, m’ is 2 and n’’ is 4. In another embodiment, m is 2, m’ is 3 and n’’ is 4. In yet another embodiment, m is 3, m’ is 0 and n’’ is 4. In yet another embodiment, m is 3, m’ is 1 and n’’ is 4. In yet another embodiment, m is 3, m’ is 2 and n’’ is 4. In yet another embodiment, m is 3, m’ is 3 and n’’ is 4. In yet a further embodiment, m is 4, m’ is 0 and n” is 4. In yet a further embodiment, m is 4, m’ is 1 and n” is 4. In yet a further embodiment, m is 4, m’ is 2 and n” is 4. In yet a further embodiment, m is 4, m’ is 3 and n” is 4. In a particular embodiment, m is 1, m’ is 0 and n’’ is 5. In a particular embodiment, m is 1, m’ is 1 and n’’ is 5. In a particular embodiment, m is 1, m’ is 2 and n’’ is 5. In a particular embodiment, m is 1, m’ is 3 and n’’ is 5. In another embodiment, m is 2, m’ is 0 and n’’ is 5. In another embodiment, m is 2, m’ is 1 and n’’ is 5. In another embodiment, m is 2, m’ is 2 and n’’ is 5. In another embodiment, m is 2, m’ is 3 and n’’ is 5. In yet another embodiment, m is 3, m’ is 0 and n’’ is 5. In yet another embodiment, m is 3, m’ is 1 and n’’ is 5. In yet another embodiment, m is 3, m’ is 2 and n’’ is 5. In yet another embodiment, m is 3, m’ is 3 and n’’ is 5. In yet a further embodiment, m is 4, m’ is 0 and n” is 5. In yet a further embodiment, m is 4, m’ is 1 and n” is 5. In yet a further embodiment, m is 4, m’ is 2 and n” is 5. In yet a further embodiment, m is 4, m’ is 3 and n” is 5. In an embodiment of the present invention, the serotype 9N glycoconjugate of the present invention are prepared using the alternative click chemistry of the present section. The invention also relates to a method of making serotype 9N glycoconjugate, as disclosed herein above. In an embodiment, click chemistry may comprise three steps, (a) reacting an isolated serotype 9N saccharide with a carbonic acid derivative and an alkyne linker in an aprotic solventto produce an activated alkynyl saccharide (activation of the saccharide), (b) reacting a carrier protein with an agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group where the NHS moiety reacts with the amino groups to form an amide linkage thereby obtaining an azido functionalized carrier protein (activation of the carrier protein), (c) reacting the activated alkynyl saccharide of step (a) with the activated azido-carrier protein of step (b) by Cu+1mediated azide- alkyne cycloaddition reaction to form a glycoconjugate. Following step (a) the saccharide is said to be activated and is referred to herein as “activated saccharide” or “activated alkynyl saccharide”. Following step (b) the carrier is said to be activated and is referred to as “activated carrier” or “activated azido-carrier”. As mentioned above, before the activation (a), sizing of the serotype 9N saccharide to a target molecular weight (MW) range may be performed. Therefore, in an embodiment, the isolated serotype 9N saccharide is sized before activation with a carbonic acid derivative and an alkyne linker. In an embodiment, the isolated serotype 9N saccharide is sized to any of the target molecular weight (MW) range defined above. In an embodiment, the isolated serotype 9N saccharide is not sized before activation with a carbonic acid derivative and an alkyne linker. In an embodiment, said carbonic acid derivative is selected from the group consisting of 1,1’-carbonyldiimidazole (CDI), 1,1’-carbonyl-di-(1,2,4-triazole) (CDT), disuccinimidyl carbonate (DSC) and N-hydroxysuccinimidyl chloroformate. In an embodiment, said carbonic acid derivative is 1,1’-carbonyldiimidazole (CDI). In another embodiment, said carbonic acid derivative is 1,1'-Carbonyl-di-(1,2,4-triazole) (CDT). In another embodiment, said carbonic acid derivative is disuccinimidyl carbonate (DSC). In yet a further embodiment, said carbonic acid derivative is N-hydroxysuccinimidyl chloroformate. In an embodiment, said carbonic acid derivative is 1,1’-carbonyldiimidazole (CDI) or 1,1'- Carbonyl-di-(1,2,4-triazole) (CDT). Preferably, said carbonic acid derivative is 1,1’- carbonyldiimidazole (CDI). In an embodiment, said alkyne linker is a compound of formula (XIV), H2N X (XIV) wherein X is selected from the group consisting of CH2, CH2(CH2)n, (CH2CH2O)mCH2CH2, NHCO(CH2)n, NHCO(CH2CH2O)mCH2CH2, OCH2(CH2)nand O(CH2CH2O)mCH2CH2; where n is selected from 1 to 10 and m is selected from 1 to 4. In an embodiment, said alkyne linker is a compound of formula (XIV), wherein X is CH2. In an embodiment, said alkyne linker is a compound of formula (XIV), wherein X is CH2(CH2)n, and n is selected from 1 to 10. In an embodiment, n is selected from 1 to 5. In an embodiment, n is selected from 1 to 4. In an embodiment, n is selected from 1 to 3. In an embodiment, n is selected from 1 to 2. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said alkyne linker is a compound of formula (XIV), wherein X is (CH2CH2O)mCH2CH2, wherein m is selected from 1 to 4. In an embodiment, m is selected from 1 to 3. In an embodiment, m is selected from 1 to 2. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4. In an embodiment, said alkyne linker is a compound of formula (XIV), wherein X is NHCO(CH2)n, and n is selected from 1 to 10. In an embodiment, n is selected from 1 to 5. In an embodiment, n is selected from 1 to 4. In an embodiment, n is selected from 1 to 3. In an embodiment, n is selected from 1 to 2. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said alkyne linker is a compound of formula (XIV), wherein X is NHCO(CH2CH2O)mCH2CH2, where m is selected from 1 to 4. In an embodiment, m is selected from 1 to 3. In an embodiment, m is selected from 1 to 2. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4. In an embodiment, said alkyne linker is a compound of formula (XIV), wherein X is OCH2(CH2)n, and n is selected from 1 to 10. In an embodiment, n is selected from 1 to 5. In an embodiment, n is selected from 1 to 4. In an embodiment, n is selected from 1 to 3. In an embodiment, n is selected from 1 to 2. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said alkyne linker is a compound of formula (XIV), wherein X is O(CH2CH2O)mCH2CH2, where m is selected from 1 to 4. In an embodiment, m is selected from 1 to 3. In an embodiment, m is selected from 1 to 2. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4. In an embodiment, said alkyne linker is a compound of formula (XV), ( XV)Hence in a preferred embodiment, said alkyne linker is propargylamine. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group is a compound of formula (XVI),where X is selected from the group consisting of (CH2)nCH2C=O and (CH2CH2O)mCH2CH2=O where n is selected from 0 to 10 and m is selected from 0 to 4. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group is a compound of formula (XVI), wherein X is (CH2)nCH2C=O, where n is selected from 0 to 10. In an embodiment, n is selected from 0 to 5. In an embodiment, n is selected from 0 to 4. In an embodiment, n is selected from 0 to 3. In an embodiment, n is selected from 0 to 2. In a particular embodiment, n is 0. In a particular embodiment, n is 1. In another embodiment, n is 2. In yet another embodiment, n is 3. In yet a further embodiment, n is 4. In yet a further embodiment, n is 5. In yet a further embodiment, n is 6. In yet a further embodiment, n is 7. In yet a further embodiment, n is 8. In yet a further embodiment, n is 9. In yet a further embodiment, n is 10. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group is a compound of formula (XVI), wherein X is (CH2CH2O)mCH2CH2=O, where m is selected from 0 to 4. In an embodiment, m is selected from 0 to 3. In an embodiment, m is selected from 0 to 2. In an embodiment, m is selected from 0 to 1. In a particular embodiment, m is 0. In a particular embodiment, m is 1. In another embodiment, m is 2. In yet another embodiment, m is 3. In yet a further embodiment, m is 4. In an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group is a compound of formula (XVII):Hence in an embodiment, said agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group is (2,5-Dioxopyrrolidin-1-yl) 2-azidoacetate. In an embodiment, step a) comprises reacting the saccharide with a carbonic acid derivative followed by reacting the carbonic acid derivative-activated saccharide with an alkyne linker in an aprotic solvent to produce an activated alkynyl saccharide. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.01-10 molar equivalent to the amount of saccharide present in the reaction mixture.In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.1-10 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.5-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 1-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 2-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 5-10 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.1-5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative that is between 0.5-2 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.01 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.1 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.2 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 0.5 molar equivalent to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 1 molar equivalent to the amount of saccharide present in the reaction mixture.In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 2 molar equivalents to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 5 molar equivalents to the amount of saccharide present in the reaction mixture. In one embodiment step a) comprises reacting the saccharide with an amount of carbonic acid derivative of about 10 molar equivalents to the amount of saccharide present in the reaction mixture. In an embodiment, at step a) the isolated saccharide is reacted with a carbonic acid derivative in an aprotic solvent. In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution comprising dimethylsulphoxide (DMSO) or dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution comprising dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution comprising dimethylsulphoxide (DMSO). In a preferred embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution comprising dimethylsulphoxide (DMSO). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylsulphoxide (DMSO) or dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylsulphoxide (DMSO). In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylacetamide. In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of N-methyl-2- pyrrolidone. In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of hexamethylphosphoramide (HMPA). In a preferred embodiment the isolated saccharide is reacted with a carbonic acid derivative in a solution consisting essentially of dimethylsulphoxide (DMSO). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in dimethylsulphoxide (DMSO) or dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in dimethylformamide (DMF). In one embodiment the isolated saccharide is reacted with a carbonic acid derivative in dimethylsulphoxide (DMSO). In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in dimethylacetamide. In an embodiment, the isolated saccharide is reacted with a carbonic acidderivative in N-methyl-2-pyrrolidone. In an embodiment, the isolated saccharide is reacted with a carbonic acid derivative in hexamethylphosphoramide (HMPA). In a preferred embodiment the isolated saccharide is reacted with CDI in dimethylsulphoxide (DMSO). In an embodiment the isolated saccharide is reacted with CDI in anhydrous DMSO. It has been surprisingly found that reacting the isolated saccharide with CDI in an environment with a moisture level of about 0.1% to 1% (v / v) allows to avoid side reactions. Therefore, in one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.2% to 1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.2% to 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.2% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.2% to 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.2% to 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.3% to 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.3% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.3% to 0.4% (v / v) water. Preferably, in one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising 0.1% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.6% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.7% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in an aprotic solvent comprising about 0.9% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.2% to 1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.2% to 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.2% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.2% to 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.2% to 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.3% to 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.3% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.3% to 0.4% (v / v) water. Preferably, in one embodiment the isolated saccharide is reacted with CDI in DMSO comprising 0.1% to 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.1% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.2% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.3% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.4% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.5% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.6% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.7% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.8% (v / v) water. In one embodiment the isolated saccharide is reacted with CDI in DMSO comprising about 0.9% (v / v) water. In one embodiment the free carbonic acid derivative is then quenched by the addition of water before the addition of the alkyne linker. Water can inactivate free CDI. Therefore, in an embodiment, carbonic acid derivative activation is followed by the addition of water. In an embodiment, water is added to bring the total water content in the mixture to between about 1% to about 10% (v / v). In an embodiment, water is added to bring the total water content in the mixture to between about 1% to about 5% (v / v). In an embodiment, water is added to bringthe total water content in the mixture to about 1 % (v / v). In an embodiment, water is added to bring the total water content in the mixture to about 2% (v / v). In an embodiment, water is added to bring the total water content in the mixture to about 5% (v / v). Once the saccharide has been reacted with carbonic acid derivative and following an eventual quenching of carbonic acid derivative with water, the carbonic acid derivative-activated saccharide is reacted with an alkyne linker. In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of alkyne linker that is between 0.01-10 molar equivalent to the amount of polysaccharide Repeat Unit of the activated saccharide (molar equivalent of RU). In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of alkyne linker that is between 0.1-5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of alkyne linker that is between 0.1-5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of alkyne linker that is between 0.5-2 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In one embodiment step a) further comprises reacting the carbonic acid derivative- activated saccharide with an amount of alkyne linker that is between 1-5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In the above embodiments, said carbonic acid derivative is preferably CDI. In another embodiment, said carbonic acid derivative is CDT. In one embodiment the degree of activation of the activated saccharide following step a) is between 0.5 to 50%. The degree of activation of the alkynyl saccharide being defined as the percentage of Repeating Unit linked to an alkyne linker. In one embodiment the degree of activation of the activated saccharide following step a) is between 1 to 30%. In another embodiment the degree of activation of the activated saccharide following step a) is between 2 to 25%. In another embodiment the degree of activation of the activated saccharide following step a) is between 3 to 20%. In another embodiment the degree of activation of the activated saccharide following step a) is between 3 to 15%. In another embodiment the degree of activation of the activated saccharide following step a) is between 4 to 15%. In an embodiment the degree of activation of the activated saccharide following step a) is between 1 to 6%. In an embodiment the degree of activation of the activated saccharide following step a) is between 3 to 6%. In an embodiment the degree of activation of the activated saccharide following step a) is between 10 to 15%.In an embodiment the degree of activation of the activated saccharide following step a) is about 1%. In an embodiment the degree of activation of the activated saccharide following step a) is about 2%. In an embodiment the degree of activation of the activated saccharide following step a) is about 3%. In an embodiment the degree of activation of the activated saccharide following step a) is about 4%. In an embodiment the degree of activation of the activated saccharide following step a) is about 5%. In an embodiment the degree of activation of the activated saccharide following step a) is about 6%. In an embodiment the degree of activation of the activated saccharide following step a) is about 7%. In an embodiment the degree of activation of the activated saccharide following step a) is about 8%. In an embodiment the degree of activation of the activated saccharide following step a) is about 9%. In an embodiment the degree of activation of the activated saccharide following step a) is about 10%. In an embodiment the degree of activation of the activated saccharide following step a) is about 11%. In an embodiment the degree of activation of the activated saccharide following step a) is about 12%. In an embodiment the degree of activation of the activated saccharide following step a) is about 13%. In an embodiment the degree of activation of the activated saccharide following step a) is about 14%. In an embodiment the degree of activation of the activated saccharide following step a) is about 15%. In an embodiment the degree of activation of the activated saccharide following step a) is about 16%. In an embodiment the degree of activation of the activated saccharide following step a) is about 17%. In an embodiment the degree of activation of the activated saccharide following step a) is about 18%. In an embodiment the degree of activation of the activated saccharide following step a) is about 19%. In an embodiment the degree of activation of the activated saccharide following step a) is about 20%. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is 0.1-10 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is 0.5-10 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is 1-5 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is 2-5 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is about 10 molar equivalents to the lysines on the carrier protein.In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is about 7.5 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is about 5 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is about 2 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is about 1 molar equivalent to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is about 0.5 molar equivalents to the lysines on the carrier protein. In one embodiment step b) comprises reacting the carrier protein with an amount of agent bearing an N-Hydroxysuccinimide (NHS) moiety and an azido group that is about 0.1 molar equivalents to the lysines on the carrier protein. In one embodiment the degree of activation of the activated carrier following step b) is between 1 and 50. The degree of activation of the activated carrier being defined as the number of lysine residues in the carrier protein that become linked to the agent bearing an N- Hydroxysuccinimide (NHS) moiety and an azido group. In an embodiment, the carrier protein is CRM197, which contains 39 lysine residues. In said embodiment the degree of activation of the activated carrier following step b) may be between 1 to 30. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 5 to 20. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 9 to 18. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 8 to 11. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is between 15 to 20. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 5. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 6. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 7. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 8. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 9. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 10. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 11. In another embodiment the degree of activation of the activated carrier (CRM197) followingstep b) is about 12. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 13. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 14. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 15. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 16. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 17. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 18. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 19. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 20. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 21. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 22. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 23. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 24. In another embodiment the degree of activation of the activated carrier (CRM197) following step b) is about 25. In an embodiment, the carrier protein is SCP or a fragment thereof. In said embodiment the degree of activation of the activated carrier following step b) may be between 1 to 50. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 5 to 50. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 7 to 45. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 5 to 15. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 20 to 30. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 30 to 50. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 30 to 40. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is between 10 to 40. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 5. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 7. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 10. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 13. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 15. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 20. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 26. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 30. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 35. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 37. In anotherembodiment the degree of activation of the activated carrier (SCP) following step b) is about 40. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 45. In another embodiment the degree of activation of the activated carrier (SCP) following step b) is about 50. In an embodiment, the carrier protein is TT or a fragment thereof. In said embodiment the degree of activation of the activated carrier following step b) may be between 1 to 30. In another embodiment the degree of activation of the activated carrier (TT) following step b) is between 5 to 25. In another embodiment the degree of activation of the activated carrier (TT) following step b) is between 7 to 25. In another embodiment the degree of activation of the activated carrier (TT) following step b) is between 10 to 20. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 5. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 7. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 10. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 12. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 15. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 20. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 25. In another embodiment the degree of activation of the activated carrier (TT) following step b) is about 30. In an embodiment, the conjugation reaction c) is carried out in aqueous buffer. In an embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence of copper (I) as catalyst. In an embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence an oxidant and of copper (I) as catalyst. In a preferred embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence of copper (I) as catalyst and ascorbate as oxidant. In an embodiment, THPTA (tris(3-hydroxypropyltriazolylmethyl)amine) and aminoguanidine may be further added to protect the protein from side reactions. Therefore, in a preferred embodiment, the conjugation reaction c) is carried out in aqueous buffer in the presence of copper (I) as catalyst and ascorbate as oxidant, wherein the reaction mixture further comprises THPTA (tris(3-hydroxypropyltriazolylmethyl)amine) and aminoguanidine. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is between 0.1 and 3. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is between 0.5 and 2. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is between 0.6 and 1.5. In a preferred embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is between 0.8 and 1. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 0.5. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrierat step c) is about 0.6. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 0.7. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 0.8. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 0.9. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.1. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.2. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.3. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.4. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.5. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.6. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.7. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.8. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 1.9. In an embodiment the initial input ratio (weight by weight) of activated alkynyl saccharide to activated azido-carrier at step c) is about 2. Following the click conjugation reaction, unreacted alkyne groups may remain present in the conjugates, these may be capped using a suitable alkyne group capping agent. In one embodiment this alkyne group capping agent is an agent bearing an azido group. In an embodiment, said alkyne group capping agent is a compound of formula (XVIII), ( XVIII) wherein X is (CH2)nwherein n is selected from 1 to 15. In one embodiment this alkyne group capping agent is 3-azido-1-propanol. Therefore, in an embodiment, following step (c) the process further comprises a step of capping the unreacted alkyne groups remained in the conjugates with an alkyne group capping agent. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.05 to 20 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.1 to 15 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide.In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 10 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 0.5 to 1 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 1 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that is between 1.5 to 2.5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 0.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 1 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 1.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 2.5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted alkyne groups is performed with an amount of capping agent that about 5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. Following the click conjugation reaction, there may remain unreacted azido groups in the conjugates, these may be capped using a suitable azido group capping agent. Therefore, in anembodiment, following step c), unreacted azido groups in the conjugates, are capped using a suitable azido group capping agent. In one embodiment this azido group capping agent is an agent bearing an alkyne group. In one embodiment this azido group capping agent is an agent bearing a terminal alkyne. In one embodiment this azido group capping agent is an agent bearing a cycloalkyne. In an embodiment, said azido group capping agent is a compound of formula (XIX), (XIX) wherein X is (CH2)nwherein n is selected from 1 to 15. In one embodiment this azido group capping agent is propargyl alcohol. Therefore, in an embodiment, following step (c) the process further comprises a step of capping the unreacted azido groups remained in the conjugates with an azido group capping agent. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.05 to 20 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 10 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.5 to 1 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 1 to 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is between 0.75 to 1.5 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 1 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide.In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 1.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 0.5 molar equivalent to the amount of polysaccharide repeat unit of the activated saccharide. In an embodiment the capping of the unreacted azido groups is performed with an amount of capping agent that is about 2 molar equivalents to the amount of polysaccharide repeat unit of the activated saccharide. Following conjugation to the carrier protein, the glycoconjugate can be purified (enriched with respect to the amount of saccharide-protein conjugate) by a variety of techniques known to the skilled person. These techniques include dialysis, concentration / diafiltration operations, tangential flow filtration precipitation / elution, column chromatography (DEAE or hydrophobic interaction chromatography), and depth filtration. Therefore, in one embodiment the process for producing the glycoconjugate of the present invention comprises the step of purifying the glycoconjugate after it is produced. In an aspect, the invention provides a serotype 9N glycoconjugate produced according to any of the methods disclosed herein. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 300kDa and 800 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.5.In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and the ratio of serotype 9N capsular polysaccharide to carrier protein in the conjugate is between 0.8 and 1.2. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and the degree of activation of the activated saccharide is between 5.0 to 35%. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and the degree of activation of the activated saccharide is between 9.0 to 32%. The degree of activation of the saccharide being defined as the percentage of Repeating Unit linked to an azido linker. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa.. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa and the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.5. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa and the saccharide to carrier protein ratio (w / w) is between 0.8 and 1.2. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.5 and the degree of activation of the activated saccharide is between 5.0 to 35%.In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.8 and 1.2 and the degree of activation of the activated saccharide is between 5.0 to 35%. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.5 and the degree of activation of the activated saccharide is between 9.0 to 32%. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and comprises a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.8 and 1.2 and the degree of activation of the activated saccharide is between 9.0 to 32%. 2.3 Carrier protein of the Streptococcus pneumoniae serotype 9N glycoconjugates of the invention A component of the glycoconjugate is a carrier protein to which the saccharide is conjugated. The terms "protein carrier" or "carrier protein" or “carrier” may be used interchangeably herein. Carrier proteins should be amenable to conjugation procedures. In a preferred embodiment, the carrier protein of the Streptococcus pneumoniae serotype 9N glycoconjugate of the invention is selected in the group consisting of: DT (Diphtheria toxoid), TT (tetanus toxoid) or fragment C of TT, CRM197(a nontoxic but antigenically identical variant of diphtheria toxin), other DT mutants (such as CRM176, CRM228, CRM45(Uchida et al. (1973) J. Biol. Chem. 218:3838-3844), CRM9, CRM102, CRM103or CRM107; and other mutations described by Nicholls and Youle in Genetically Engineered Toxins, Ed: Frankel, Maecel Dekker Inc. (1992); deletion or mutation of Glu-148 to Asp, Gln or Ser and / or Ala 158 to GIy and other mutations disclosed in U.S. Patent Nos.4,709,017 and 4,950,740; mutation of at least one or more residues Lys 516, Lys 526, Phe 530 and / or Lys 534 and other mutations disclosed in U.S. Patent Nos. 5,917,017 and 6,455,673; or fragment disclosed in U.S. Patent No. 5,843,711, pneumococcal pneumolysin (ply) (Kuo et al. (1995) Infect lmmun 63:2706-2713) including ply detoxified in some fashion, for example dPLY-GMBS (WO 2004 / 081515, WO 2006 / 032499) or dPLY-formol, PhtX, including PhtA, PhtB, PhtD, PhtE (sequences of PhtA, PhtB, PhtD or PhtE are disclosed in WO 00 / 37105 and WO 00 / 39299) and fusions of Pht proteins, for example PhtDE fusions, PhtBEfusions, Pht A-E (WO 01 / 98334, WO 03 / 054007, WO 2009 / 000826), OMPC (meningococcal outer membrane protein), which is usually extracted from Neisseria meningitidis serogroup B (EP0372501), PorB (from N. meningitidis), PD (Haemophilus influenzae protein D; see, e.g., EP0594610 B), or immunologically functional equivalents thereof, synthetic peptides (EP0378881, EP0427347), heat shock proteins (WO 93 / 17712, WO 94 / 03208), pertussis proteins (WO 98 / 58668, EP0471177), cytokines, lymphokines, growth factors or hormones (WO 91 / 01146), artificial proteins comprising multiple human CD4+ T cell epitopes from various pathogen derived antigens (Falugi et al. (2001) Eur J Immunol 31:3816-3824) such as N19 protein (Baraldoi et al. (2004) Infect lmmun 72:4884-4887) pneumococcal surface protein PspA (WO 02 / 091998), iron uptake proteins (WO 01 / 72337), toxin A or B of Clostridium difficile (WO 00 / 61761), transferrin binding proteins, pneumococcal adhesion protein (PsaA), recombinant Pseudomonas aeruginosa exotoxin A (in particular non-toxic mutants thereof (such as exotoxin A bearing a substution at glutamic acid 553 (Douglas et al. (1987) J. Bacteriol. 169(11):4967- 4971)). Other proteins, such as ovalbumin, keyhole limpet hemocyanin (KLH), bovine serum albumin (BSA) or purified protein derivative of tuberculin (PPD) also can be used as carrier proteins. Other suitable carrier proteins include inactivated bacterial toxins such as cholera toxoid (e.g., as described in WO 2004 / 083251), Escherichia coli LT, E. coli ST, and exotoxin A from P. aeruginosa. Another suitable carrier protein is a C5a peptidase from Streptococcus (SCP). Another suitable carrier protein is rhizavidin [aa 45-179J-GGGGSSS-SP1500- AAA-SP0785] (CP1) (WO2020056202). Another suitable carrier protein is Rhavi-linker-PdT(G294P)-linker- SP0435 [aa 62-185] fusion protein (SPP2), see WO2023039223. WO2020 / 056202 and WO2023 / 039223 are incorporated by reference. SPP2 is described in particular at sections

[0245] to

[0250] of WO2023 / 039223. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is rhizavidin [aa 45-179J-GGGGSSS-SP1500- AAA-SP0785] (CP1). In another embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is Rhavi-linker-PdT(G294P)-linker-SP0435 [aa 62-185] fusion protein (SPP2). In an embodiment, said SPP2 has the amino acid sequence as set forth at SEQ ID NO: 19 of WO2023 / 039223. In a preferred embodiment, the carrier protein of the serotype 9N capsular polysaccharide glycoconjugate of the invention is selected from the group consisting of TT, DT, DT mutants (such as CRM197), and a C5a peptidase from Streptococcus (SCP). In a preferred embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is TT, DT, DT mutants (such as CRM197) or a C5a peptidase from Streptococcus (SCP). In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is DT (Diphtheria toxoid). In another embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is TT (tetanus toxoid).In another embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is PD (H. influenzae protein D; see, e.g., EP0594610 B). In a preferred embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is CRM197or a C5a peptidase from Streptococcus (SCP). In a preferred embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is CRM197 protein. The CRM197 protein is a nontoxic form of diphtheria toxin but is immunologically indistinguishable from the diphtheria toxin. CRM197is produced by Corynebacterium diphtheriae infected by the nontoxigenic phage β197tox-created by nitrosoguanidine mutagenesis of the toxigenic corynephage beta (Uchida et al. (1971) Nature New Biology 233:8-11). The CRM197protein has the same molecular weight as the diphtheria toxin but differs therefrom by a single base change (guanine to adenine) in the structural gene. This single base change causes an amino acid substitution (glutamic acid for glycine) in the mature protein and eliminates the toxic properties of diphtheria toxin. The CRM197protein is a safe and effective T-cell dependent carrier for saccharides. Further details about CRM197and production thereof can be found, e.g., in U.S. Patent No.5,614,382. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the present invention is CRM197protein or the A chain of CRM197(see CN103495161). In an embodiment the carrier protein of the serotype 9N glycoconjugate of the present invention is the A chain of CRM197obtained via expression by genetically recombinant E. coli (see CN103495161). In very preferred embodiments, the carrier protein of the serotype 9N glycoconjugate of the present invention is SCP (Streptococcal C5a Peptidase). Two important species of β-hemolytic streptococci, Streptococcus pyogenes (group A Streptococcus, GAS) and Streptococcus agalactiae (group B Streptococcus, GBS), which cause a variety of serious human infections that range from mild cases of pharyngitis and impetigo to serious invasive diseases such as necrotizing fasciitis (GAS) and neonatal sepsis (GBS) have developed a way to defeat this immune response. All human isolates of β-hemolytic streptococci, including GAS and GBS, produce a highly conserved cell-wall protein SCP (Streptococcal C5a Peptidase) that specifically inactivates C5a. The scp genes from GAS and GBS encode a polypeptide containing between 1,134 and 1,181 amino acids (Brown et al., PNAS, 2005, vol. 102, no.51 pages 18391–18396). The first 31 residues are the export signal presequence and are removed upon passing through the cytoplasmic membrane. The next 68 residues serve as a pro-sequence and must be removed to produce active SCP. The next 10 residues can be removed without loss of protease activity. At the other end, starting with Lys-1034, are four consecutive 17-residue motifs followed by a cell sorting and cell-wall attachment signal. This combined signal is composed of a 20-residue hydrophilic sequence containing an LPTTND sequence, a 17-residue hydrophobic sequence, and a short basic carboxyl terminus. SCP can be divided in domains (see figure 1B of Brown et al., PNAS, 2005, vol.102, no. 51 pages 18391–18396). These domains are the Pre / Pro domain (which comprises the exportsignal presequence (commonly the first 31 residues) and the pro-sequence (commonly the next 68 residues)), the protease domain (which is splitted in two part (protease part 1 commonly residues 89–333 / 334 and protease domain part 2 and commonly residues 467 / 468–583 / 584), the protease-associated domain (PA domain) (commonly residues 333 / 334–467 / 468), three fibronectin type III (Fn) domains (Fn1, commonly residues 583 / 584–712 / 713; Fn2, commonly residues 712 / 713–928 / 929 / 930; commonly Fn3, residues 929 / 930-1029 / 1030 / 1031) and a cell wall anchor domain (commonly redisues 1029 / 1030 / 1031 to the C-terminus). In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an SCP from GBS (SCPB). An exemple of SCPB is provided at SEQ. ID.NO: 3 of WO97 / 26008. See also SEQ ID NO: 3 of WO00 / 34487. In another preferred embodiments, the carrier protein of the serotype 9N glycoconjugate of the invention is an SCP from GAS (SCPA). Examples of SCPA can be found at SEQ.ID.No.1 and SEQ.ID.No.2 of WO97 / 26008. See also SEQ ID NO: 1, 2 and 23 of WO00 / 34487. In a preferred embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive SCP. In other preferred embodiments, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive SCP from GBS (SCPB). In another preferred embodiments, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive SCP from GAS (SCPA). In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is a fragment of an SCP. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is a fragment of an SCPA. Preferably, the carrier protein of the serotype 9N glycoconjugate of the invention is a fragment of an SCPB. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is a fragment of an SCP which comprises the protease domain, the protease-associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is a fragment of an SCP which comprises the protease domain, the protease-associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of an SCP which comprises the protease domain, the protease-associated domain (PA domain) and two of the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of an SCP. In an embodiment, said enzymatically inactivefragment of SCP comprises the protease domain, the protease-associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of an SCPA. In an embodiment, said enzymatically inactive fragment of an SCPA comprises the protease domain, the protease-associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain. In a preferred embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of SCPB. Preferably, said enzymatically inactive fragment of SCPB comprises the protease domain, the protease-associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain. In an embodiment, the enzymatic activity of SCP is inactivated by replacing at least one amino acid of the wild type sequence. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. The numbers indicate the amino acid residue position in the peptidase according to the numbering of SEQ ID NO: 1 of WO00 / 34487. Therefore, in an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive SCP where said inactivation is accomplished by replacing at least one amino acid of the wild type sequence. Preferably, said replacement of at least one amino acid is in the protease domain. In an embodiment, said replacement of at least one amino acid is in part 1 of the protease domain. In an embodiment, said replacement of at least one amino acid is in part 2 of the protease domain. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. In an embodiment, said replacement is D130A. In another embodiment, said replacement is H193A. In another embodiment, said replacement is N295A. In yet another embodiment, said replacement is S512A. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive SCPA where said inactivation is accomplished by replacing at least one amino acid of the wild type sequence. Preferably, said replacement of at least one amino acid is in the protease domain. In an embodiment, said replacement of at least one amino acid is in part 1 of the protease domain. In an embodiment, said replacement of at least one amino acid is in part 2 of the protease domain. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. In an embodiment, said replacement is D130A. In another embodiment, said replacement is H193A. In another embodiment, said replacement is N295A. In yet another embodiment, said replacement is S512A. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive SCPB where said inactivation is accomplished by replacing at least one amino acid of the wild type sequence. Preferably, said replacement of at least one aminoacid is in the protease domain. In an embodiment, said replacement of at least one amino acid is in part 1 of the protease domain. In an embodiment, said replacement of at least one amino acid is in part 2 of the protease domain. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. In an embodiment, said replacement is D130A. In another embodiment, said replacement is H193A. In another embodiment, said replacement is N295A. In yet another embodiment, said replacement is S512A. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of an SCP where said inactivation is accomplished by replacing at least one amino acid of the wild type sequence. Preferably, said replacement of at least one amino acid is in the protease domain. In an embodiment, said replacement of at least one amino acid is in part 1 of the protease domain. In an embodiment, said replacement of at least one amino acid is in part 2 of the protease domain. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. In an embodiment, said replacement is D130A. In another embodiment, said replacement is H193A. In another embodiment, said replacement is N295A. In yet another embodiment, said replacement is S512A. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of SCP which comprises the protease domain, the protease- associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain, where said inactivation is accomplished by replacing at least one amino acid of the wild type sequence. Preferably, said replacement of at least one amino acid is in the protease domain. In an embodiment, said replacement of at least one amino acid is in part 1 of the protease domain. In an embodiment, said replacement of at least one amino acid is in part 2 of the protease domain. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. In an embodiment, said replacement is D130A. In another embodiment, said replacement is H193A. In another embodiment, said replacement is N295A. In yet another embodiment, said replacement is S512A. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of SCPA which comprises the protease domain, the protease-associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain, where said inactivation is accomplished by replacing at least one amino acid of the wild type sequence. Preferably, said replacement of at least one amino acid is in the protease domain. In an embodiment, said replacement of at least one amino acid is in part 1 of the protease domain. In an embodiment, said replacement of at least one amino acid is in part 2 of the protease domain. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. In an embodiment, said replacement is D130A. In another embodiment, saidreplacement is H193A. In another embodiment, said replacement is N295A. In yet another embodiment, said replacement is S512A. In an embodiment, the carrier protein of the serotype 9N glycoconjugate of the invention is an enzymatically inactive fragment of SCPB which comprises the protease domain, the protease-associated domain (PA domain) and the three fibronectin type III (Fn) domains but does not comprise the export signal presequence, the pro-sequence and the cell wall anchor domain, where said inactivation is accomplished by replacing at least one amino acid of the wild type sequence. Preferably, said replacement of at least one amino acid is in the protease domain. In an embodiment, said replacement of at least one amino acid is in part 1 of the protease domain. In an embodiment, said replacement of at least one amino acid is in part 2 of the protease domain. In an embodiment, said replacement is selected from the group consisting of D130A, H193A, N295A and S512A. In an embodiment, said replacement is D130A. In another embodiment, said replacement is H193A. In another embodiment, said replacement is N295A. In yet another embodiment, said replacement is S512A. In an embodiment, the enzymatic activity of SCP is inactivated by replacing at least two amino acids of the wild type sequence. In an embodiment, said at least two amino acids replacements are selected from the group consistin...

Claims

Claims 1. A Streptococcus pneumoniae serotype 9N glycoconjugate comprising a serotype 9N capsular polysaccharide wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 50 kDa and 1,000 kDa and wherein said serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,500 kDa and 4,500 kDa.

2. The Streptococcus pneumoniae serotype 9N glycoconjugate of claim 1 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 200 kDa and 500 kDa, wherein the degree of conjugation of said serotype 9N glycoconjugate is between 4 and 12, wherein the ratio of serotype 9N polysaccharide to carrier protein in the glycoconjugate (w / w) is between 0.5 and 1.5 and wherein said serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,500 kDa and 4,500 kDa.

3. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 1-2, wherein said serotype 9N glycoconjugate is prepared by direct reductive amination.

4. The Streptococcus pneumoniae serotype 9N glycoconjugate of claim 1, wherein said serotype 9N glycoconjugate is prepared click chemistry.

5. The Streptococcus pneumoniae serotype 9N glycoconjugate of claim 1, wherein said serotype 9N glycoconjugate comprises a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (IV):(IV), wherein X is selected from the group consisting of CH2(CH2)n’, (CH2CH2O)mCH2CH2, NHCO(CH2)n’, NHCO(CH2CH2O)mCH2CH2, OCH2(CH2)n’and O(CH2CH2O)mCH2CH2; where n’ is selected from 1 to 10 and m is selected from 1 to 4, wherein X' is selected from the group consisting of CH2O(CH2)n’’CH2C=O, CH2O(CH2CH2O)m’(CH2)n’’CH2C=O, where n’’ is selected from 0 to 10 and m’ is selected from 0 to 4, wherein the structure in square backet represents a repeat unit of the serotype 9N saccharide and wherein n represents the number of repeating units.

6. The Streptococcus pneumoniae serotype 9N glycoconjugate of claim 1, wherein said serotype 9N glycoconjugate comprises a serotype 9N saccharide covalently conjugated to a carrier protein (CP) through a spacer and having the general formula (XIII),(XIII). wherein the structure in square backet represents a repeat unit of the serotype 9N saccharide and wherein n represents the number of repeating units.

7. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 300kDa and 800 kDa.

8. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa.

9. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa.

10. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 having a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa.

11. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 having a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa.

12. In an embodiment, the serotype 9N glycoconjugate of the present invention is prepared by click chemistry and the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.

5.

13. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the ratio of serotype 9N capsular polysaccharide to carrier protein in the conjugate is between 0.8 and 1.

2.

14. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the degree of activation of the activated saccharide is between 5.0 to 35%.

15. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the degree of activation of the activated saccharide is between 9.0 to 32%.

16. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa.

17. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation isbetween 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa.

18. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa and the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.

5.

19. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa and the saccharide to carrier protein ratio (w / w) is between 0.8 and 1.

2.

20. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.5 and the degree of activation of the activated saccharide is between 5.0 to 35%.

21. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.8 and 1.2 and the degree of activation of the activated saccharide is between 5.0 to 35%.

22. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 400kDa and 750 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 1,000 kDa and 5,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.5 and 1.5 and the degree of activation of the activated saccharide is between 9.0 to 32%.

23. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 4-6 wherein the weight average molecular weight (Mw) of said polysaccharide before conjugation is between 500kDa and 700 kDa and the serotype 9N glycoconjugate has a weight average molecular weight (Mw) of between 2,000 kDa and 4,000 kDa, the saccharide to carrier protein ratio (w / w) is between 0.8 and 1.2 and the degree of activation of the activated saccharide is between 9.0 to 32%.

24. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 1-23, wherein the carrier protein of said serotype 9N capsular polysaccharide glycoconjugate is CRM197.

25. The Streptococcus pneumoniae serotype 9N glycoconjugate of any one of claims 1-23, wherein the carrier protein of said serotype 9N capsular polysaccharide glycoconjugate is SCP (Streptococcal C5a Peptidase).

26. An immunogenic composition comprising a Streptococcus pneumoniae serotype 9N glycoconjugate of any one of paragraphs 1-25.

27. An immunogenic composition comprising a Streptococcus pneumoniae serotype 9N glycoconjugate of any one of paragraphs 1-25 and comprising glycoconjugates from 21 to 35 different serotypes of S. pneumoniae.

28. An immunogenic composition comprising a Streptococcus pneumoniae serotype 9N glycoconjugate of any one of paragraphs 1-25 and further comprising glycoconjugates from S. pneumoniae serotypes 1, 2, 3, 4, 5, 6A, 6B, 6C, 8, 7C, 7F, 9V, 10A, 11A, 12F, 14, 15A, 15B, 16F, 17F, 18C, 19A, 19F, 20A, 22F, 23A, 23B, 23F, 24F, 31, 33F, 35B and 38.

29. The glycoconjugate of any one of claims 1-25 for use as an antigen.

30. The glycoconjugate of any one of paragraphs 1-25 or the immunogenic composition of any one of claims 26-28 for use as a medicament.

31. The glycoconjugate of any one of paragraphs 1-25 or the immunogenic composition of any one of claims 26-28 for use as a vaccine.

32. The glycoconjugate of any one of paragraphs 1-25 or the immunogenic composition of any one of claims 26-28 for use is a method of preventing, treating or ameliorating a S. pneumoniae serotype 9N infection, disease or condition in a subject.

33. A method of making a Streptococcus pneumoniae serotype 9N glycoconjugate, using click chemistry said method comprising the steps of (a) reacting an isolated serotype 9N saccharide with a carbonic acid derivative and an azido linker in an aprotic solvent to produce an activated azido saccharide (activation of the saccharide), (b) reacting a carrier protein with an agent bearing an N-Hydroxysuccinimide (NHS) moiety and an alkyne group where the NHS moiety reacts with the amino groups to form an amide linkage thereby obtaining an alkyne functionalized carrier protein (activation of the carrier protein), (c) reacting the activated azido saccharide of step (a) with the activated alkyne-carrier protein of step (b) by Cu+1mediated azide-alkyne cycloaddition reaction to form a glycoconjugate.

34. A method of making a Streptococcus pneumoniae serotype 9N glycoconjugate, comprising the step of: (a) reacting said serotype 9N saccharide with an oxidizing agent; (b) compounding the activated saccharide of step (a) with a carrier protein; and (c) reacting the compounded activated saccharide and carrier protein with a reducing agent to form a glycoconjugate.